CAS 2360-20-5
:3,4-Diaminobenzenesulfonamide
Description:
3,4-Diaminobenzenesulfonamide, also known as sulfanilamide, is an aromatic sulfonamide compound characterized by the presence of both amino groups and a sulfonamide functional group attached to a benzene ring. It typically appears as a white to off-white crystalline solid and is soluble in water, which is a notable property for its applications in pharmaceuticals. The compound exhibits antibacterial properties, making it significant in the development of sulfa drugs, which were among the first antibiotics used to treat bacterial infections. Its structure includes two amine groups (-NH2) positioned at the 3 and 4 carbon atoms of the benzene ring, contributing to its reactivity and biological activity. 3,4-Diaminobenzenesulfonamide is also used in various chemical syntheses and as a reagent in analytical chemistry. Safety considerations include potential allergic reactions and toxicity, necessitating careful handling in laboratory and clinical settings. Overall, its unique chemical structure and properties make it an important compound in medicinal chemistry and pharmacology.
Formula:C6H9N3O2S
InChI:InChI=1S/C6H9N3O2S/c7-5-2-1-4(3-6(5)8)12(9,10)11/h1-3H,7-8H2,(H2,9,10,11)
InChI key:InChIKey=QULXUUQWVHVHSM-UHFFFAOYSA-N
SMILES:S(N)(=O)(=O)C1=CC(N)=C(N)C=C1
Synonyms:- 3,4-Diamino-benzenesulfonamide
- 3,4-Diamino-benzenesulfonic acid amide
- 3,4-Diaminobenzene-1-sulfonamide
- Benzenesulfonamide, 3,4-Diamino-
- 3,4-Diaminobenzenesulfonamide
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
Benzenesulfonamide, 3,4-diamino-
CAS:Formula:C6H9N3O2SPurity:95%Color and Shape:SolidMolecular weight:187.21963,4-Diaminobenzenesulphonamide
CAS:3,4-DiaminobenzenesulphonamidePurity:95%Color and Shape:PowderMolecular weight:187.22g/mol3,4-Diaminobenzenesulphonamide
CAS:<p>3,4-Diaminobenzenesulphonamide is a chemical compound that is used as an intermediate in organic synthesis and non-apoptotic cell death. 3,4-Diaminobenzenesulphonamide reacts with iron chloride to form ferroptosis, an environmental pollutant. It can also be used for the treatment of various cancers. 3,4-Diaminobenzenesulphonamide binds to the iron in the cell and causes cell death by forming reactive oxygen species that induce ferroptosis. 3,4-Diaminobenzenesulphonamide is also a non-apoptotic cell death agent that inhibits mitochondrial membrane potential and leads to cellular necrosis.</p>Formula:C6H9N3O2S·2ClHPurity:Min. 95%Molecular weight:260.14 g/mol



