CAS 23600-77-3
:Phenol, 4-bromo-, 1-propanoate
Description:
Phenol, 4-bromo-, 1-propanoate, also known as 4-bromo-phenyl propanoate, is an organic compound characterized by the presence of a bromine atom at the para position of the phenolic ring and an ester functional group derived from propanoic acid. This compound typically appears as a colorless to pale yellow liquid or solid, depending on its purity and specific conditions. It is soluble in organic solvents like ethanol and ether but has limited solubility in water due to its hydrophobic aromatic structure. The presence of the bromine atom enhances its reactivity, making it useful in various chemical synthesis applications, including as an intermediate in the production of pharmaceuticals and agrochemicals. Additionally, the compound may exhibit biological activity, which can be explored in medicinal chemistry. Safety precautions should be taken when handling this substance, as it may pose health risks, including skin and respiratory irritation. Proper storage and disposal methods should be followed to mitigate environmental impact.
Formula:C9H9BrO2
InChI:InChI=1S/C9H9BrO2/c1-2-9(11)12-8-5-3-7(10)4-6-8/h3-6H,2H2,1H3
InChI key:InChIKey=JPUYGYIPZTYGTI-UHFFFAOYSA-N
SMILES:O(C(CC)=O)C1=CC=C(Br)C=C1
Synonyms:- 4-Bromophenyl Propanoate
- Ai3-17712
- NSC 52968
- Phenol, 4-bromo-, 1-propanoate
- Phenol, 4-bromo-, propanoate
- Phenol, p-bromo-, propionate
- p-Bromophenyl propionate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
