CAS 23600-83-1

1-[4-(phenylamino)phenyl]ethanone

Description:

1-[4-(Phenylamino)phenyl]ethanone, also known as N-(4-acetylphenyl)aniline, is an organic compound characterized by its structure, which includes an ethanone group attached to a phenyl ring that is further substituted with an aniline moiety. This compound typically appears as a solid at room temperature and is soluble in organic solvents such as ethanol and acetone, but may have limited solubility in water due to its hydrophobic nature. It exhibits properties typical of aromatic compounds, including a distinct melting point and boiling point, which are influenced by its molecular interactions. The presence of both the ketone and amine functional groups allows for potential reactivity in various chemical reactions, such as nucleophilic substitutions or condensation reactions. Additionally, this compound may have applications in organic synthesis, dye production, or as an intermediate in pharmaceuticals, owing to its structural features that can facilitate further chemical modifications. Safety data should be consulted for handling and potential hazards associated with this substance.

Formula: C₁₄H₁₃NO

InChI: InChI=1/C14H13NO/c1-11(16)12-7-9-14(10-8-12)15-13-5-3-2-4-6-13/h2-10,15H,1H3

SMILES: CC(=O)c1ccc(cc1)Nc1ccccc1

Synonyms:

• 1-(4-Anilinophenyl)ethanone
• Ethanone, 1-[4-(Phenylamino)Phenyl]-

Ethanone, 1-​[4-​(phenylamino)​phenyl]​-

CAS: 23600-83-1

Formula: C₁₄H₁₃NO

Purity: 98%

Color and Shape: Solid

Molecular weight: 211.2591

Ref: IN-DA002NUV

1-(4-(Phenylamino)phenyl)ethanone

CAS: 23600-83-1

1-(4-(Phenylamino)phenyl)ethanone

Purity: 98%

Molecular weight: 211.26g/mol

Ref: 54-OR1068010

1-(4-(Phenylamino)phenyl)ethanone

CAS: 23600-83-1

Formula: C₁₄H₁₃NO

Purity: ≥98%

Molecular weight: 211.264

Ref: 10-F336895