CAS 23602-98-4
:dibenzo[b,d]furan-2-sulfonyl chloride
Description:
Dibenzo[b,d]furan-2-sulfonyl chloride is an organic compound characterized by its sulfonyl chloride functional group attached to a dibenzo[b,d]furan structure. This compound typically appears as a white to light yellow solid and is known for its reactivity, particularly due to the presence of the sulfonyl chloride group, which can undergo nucleophilic substitution reactions. It is often used as a reagent in organic synthesis, particularly in the preparation of sulfonamides and other sulfonyl derivatives. The compound is soluble in organic solvents such as dichloromethane and chloroform but is generally insoluble in water. Safety precautions are necessary when handling this compound, as it can be corrosive and may release toxic gases upon reaction with water or moisture. Its applications extend to medicinal chemistry and materials science, where it serves as an intermediate in the synthesis of various bioactive molecules. Proper storage in a cool, dry place away from moisture is recommended to maintain its stability and reactivity.
Formula:C12H7ClO3S
InChI:InChI=1/C12H7ClO3S/c13-17(14,15)8-5-6-12-10(7-8)9-3-1-2-4-11(9)16-12/h1-7H
SMILES:c1ccc2c(c1)c1cc(ccc1o2)S(=O)(=O)Cl
Synonyms:- 2-Dibenzofuransulfonyl chloride
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
2-Dibenzofuransulfonyl chloride
CAS:Formula:C12H7ClO3SPurity:95%Color and Shape:SolidMolecular weight:266.7002Dibenzo[b,d]furan-2-sulphonyl chloride
CAS:Dibenzo[b,d]furan-2-sulphonyl chloridePurity:≥95%Color and Shape:SolidMolecular weight:266.70g/molDibenzo[b,d]furan-2-sulfonyl chloride
CAS:Purity:97.0%Color and Shape:Solid, White powderMolecular weight:266.70001220703125Dibenzo[b,d]furan-2-sulfonyl chloride
CAS:<p>Dibenzo[b,d]furan-2-sulfonyl chloride is a versatile compound with various applications in research and chemical synthesis. It is commonly used in singlet fission studies, where it acts as a sensitizer to enhance the efficiency of energy transfer. Additionally, dibenzo[b,d]furan-2-sulfonyl chloride is utilized in the synthesis of jatrorrhizine hydrochloride, a natural alkaloid with potential medicinal properties.</p>Formula:C12H7ClO3SPurity:Min. 95%Molecular weight:266.7 g/mol



