CAS 23604-21-9

Guanidine, N-octadecyl-, hydrochloride (1:1)

Description:

Guanidine, N-octadecyl-, hydrochloride (1:1), with the CAS number 23604-21-9, is a quaternary ammonium compound characterized by its long hydrophobic octadecyl chain and a guanidine functional group. This substance typically appears as a white to off-white solid and is soluble in water due to the presence of the hydrochloride salt form, which enhances its ionic character. The guanidine moiety contributes to its basicity and potential biological activity, making it of interest in various applications, including as a surfactant, antimicrobial agent, or in drug formulation. Its long alkyl chain provides surfactant properties, allowing it to interact with lipid membranes, which can influence its behavior in biological systems. Additionally, the compound may exhibit unique properties related to its surface activity, stability, and interaction with other molecules, making it valuable in both industrial and research contexts. Safety data should be consulted for handling and potential toxicity, as with any chemical substance.

Formula: C₁₉H₄₁N₃·ClH

InChI: InChI=1S/C19H41N3.ClH/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-22-19(20)21;/h2-18H2,1H3,(H4,20,21,22);1H

InChI key: InChIKey=WPUFMGPAQNCUGT-UHFFFAOYSA-N

SMILES: C(CCCCCCCCCCCC)CCCCCNC(=N)N.Cl

Synonyms:

• Guanidine, octadecyl-, monohydrochloride
• N-(Octadecan-1-yl) guanidine hydrochloride
• Guanidine, N-octadecyl-, hydrochloride (1:1)

1-Octadecylguanidine Hydrochloride

CAS: 23604-21-9

Formula: C₁₉H₄₁N₃·HCl

Purity: >98.0%(T)

Color and Shape: White to Light yellow powder to crystal

Molecular weight: 348.02

Ref: 3B-O0600