CAS 23609-99-6

4-(4-chloro-3-methylphenoxy)butanoate

Description:

4-(4-chloro-3-methylphenoxy)butanoate, identified by its CAS number 23609-99-6, is an organic compound characterized by its ester functional group. This substance features a butanoate moiety linked to a phenoxy group, which contains a chlorinated and methyl-substituted aromatic ring. The presence of the chlorine atom and the methyl group on the aromatic ring contributes to its unique chemical properties, including potential biological activity. The compound is likely to exhibit moderate solubility in organic solvents due to its hydrophobic aromatic structure, while the butanoate portion may impart some degree of polarity. Its molecular structure suggests potential applications in fields such as agrochemicals or pharmaceuticals, where compounds with specific biological activities are of interest. Additionally, the presence of chlorine may influence its reactivity and stability, making it a candidate for further study in synthetic chemistry or material science. As with any chemical substance, safety data and handling precautions should be reviewed before use.

Formula: C₁₁H₁₂ClO₃

InChI: InChI=1/C11H13ClO3/c1-8-7-9(4-5-10(8)12)15-6-2-3-11(13)14/h4-5,7H,2-3,6H2,1H3,(H,13,14)/p-1

SMILES: Cc1cc(ccc1Cl)OCCCC(=O)[O-]

Synonyms:

• butanoic acid, 4-(4-chloro-3-methylphenoxy)-

4-(4-Chloro-3-methylphenoxy)butanoic acid

Controlled Product

CAS: 23609-99-6

Versatile small molecule scaffold

Formula: C₁₁H₁₃ClO₃

Purity: Min. 95%

Molecular weight: 228.67 g/mol

Ref: 3D-YAA60999