CAS 236093-08-6
:3-fluoro-8-nitroquinoline
Description:
3-Fluoro-8-nitroquinoline is a heterocyclic organic compound characterized by the presence of a quinoline ring system, which consists of a fused benzene and pyridine structure. The compound features a fluorine atom at the 3-position and a nitro group at the 8-position of the quinoline ring, contributing to its unique chemical properties. It is typically a yellow to orange solid, exhibiting moderate solubility in organic solvents. The presence of the nitro group enhances its electron-withdrawing characteristics, which can influence its reactivity and potential applications in medicinal chemistry, particularly in the development of pharmaceuticals. The fluorine substituent can also affect the compound's lipophilicity and biological activity. 3-Fluoro-8-nitroquinoline may be utilized in various chemical syntheses and as a building block in the design of more complex molecules. As with many nitro-containing compounds, it is important to handle it with care due to potential toxicity and environmental concerns.
Formula:C9H5FN2O2
InChI:InChI=1/C9H5FN2O2/c10-7-4-6-2-1-3-8(12(13)14)9(6)11-5-7/h1-5H
Synonyms:- 3-Fluoro-8-nitroquinoline
- Quinoline, 3-fluoro-8-nitro-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.