CAS 23612-36-4

3-bromo-1H-pyrrolo[3,2-c]pyridine

Description:

3-Bromo-1H-pyrrolo[3,2-c]pyridine is a heterocyclic organic compound characterized by its fused pyrrole and pyridine rings, which contribute to its unique chemical properties. The presence of a bromine atom at the 3-position enhances its reactivity, making it a valuable intermediate in organic synthesis and medicinal chemistry. This compound typically exhibits a pale yellow to brown appearance and is soluble in organic solvents such as dimethyl sulfoxide (DMSO) and dichloromethane. Its molecular structure allows for potential interactions with biological targets, making it of interest in drug discovery. The compound may also display interesting electronic properties due to the conjugated system formed by the fused rings. Additionally, it can participate in various chemical reactions, including nucleophilic substitutions and cross-coupling reactions, which are essential in the development of more complex molecules. Safety data should be consulted, as halogenated compounds can pose health risks, and appropriate handling and disposal procedures should be followed in laboratory settings.

Formula: C₇H₅BrN₂

InChI: InChI=1/C7H5BrN2/c8-6-4-10-7-1-2-9-3-5(6)7/h1-4,10H

SMILES: c1cncc2c(c[nH]c12)Br

Synonyms:

• 3-Bromo-5-azaindole
• 3-Bromo-1H-pyrrolo[3,2-c]pyridine

1H-Pyrrolo[3,2-c]pyridine, 3-bromo-

CAS: 23612-36-4

Formula: C₇H₅BrN₂

Purity: 97%

Color and Shape: Solid

Molecular weight: 197.0320

Ref: IN-DA002NWL

3-Bromo-5-azaindole

CAS: 23612-36-4

3-Bromo-5-azaindole

Formula: C₇H₅BrN₂

Purity: 97%

Color and Shape: yellow solid

Molecular weight: 197.03g/mol

Ref: 54-OR30681

3-Bromo-5-azaindole

CAS: 23612-36-4

Purity: 98%

Molecular weight: 197.03

Ref: FT-B10818

3-Bromo-1H-pyrrolo[3,2-c]pyridine

CAS: 23612-36-4

Formula: C₇H₅BrN₂

Purity: 95%

Molecular weight: 197.035

Ref: 10-F242147