CAS 23612-48-8
:2-Methyl-7-azaindole
Description:
2-Methyl-7-azaindole is a heterocyclic organic compound characterized by its fused ring structure, which includes both nitrogen and carbon atoms. It belongs to the class of azaindoles, where one of the carbon atoms in the indole structure is replaced by a nitrogen atom. This compound typically exhibits a pale yellow to brownish appearance and is soluble in organic solvents. Its molecular formula reflects the presence of a methyl group at the second position and a nitrogen atom at the seventh position of the indole framework, contributing to its unique chemical properties. 2-Methyl-7-azaindole is of interest in various fields, including medicinal chemistry, due to its potential biological activities and applications in drug development. The presence of the nitrogen atom can influence its reactivity and interactions with biological targets, making it a subject of research in the synthesis of novel pharmaceuticals. Additionally, its structural features may impart specific electronic properties, which can be exploited in materials science and organic electronics.
Formula:C8H8N2
InChI:InChI=1/C8H8N2/c1-6-5-7-3-2-4-9-8(7)10-6/h2-5H,1H3,(H,9,10)
SMILES:Cc1cc2cccnc2[nH]1
Synonyms:- 1H-pyrrolo[2,3-b]pyridine, 2-methyl-
- 2-Methyl-1H-pyrrolo[2,3-b]pyridin
- 2-methyl-1H-pyrrolo[2,3-b]pyridine
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
1H-Pyrrolo[2,3-b]pyridine, 2-methyl-
CAS:Formula:C8H8N2Purity:97%Color and Shape:SolidMolecular weight:132.16252-Methyl-7-azaindole
CAS:2-Methyl-7-azaindole is a high purity biochemical reagent that can be used in research related to life sciences.Formula:C8H8N2Purity:99.23%Color and Shape:SolidMolecular weight:132.162-Methyl-7-azaindole
CAS:2-Methyl-7-azaindoleFormula:C8H8N2Purity:98%Color and Shape: white solidMolecular weight:132.16g/mol2-Methyl-1H-pyrrolo[2,3-b]pyridine
CAS:Controlled ProductApplications 2-methyl-1H-pyrrolo[2,3-b]pyridine (cas# 23612-48-8) is a useful research chemical.
Formula:C8H8N2Color and Shape:NeatMolecular weight:132.16




