CAS 23612-57-9

2-Aminopyridine-3-methanol

Description:

2-Aminopyridine-3-methanol, with the CAS number 23612-57-9, is an organic compound characterized by the presence of both an amino group and a hydroxymethyl group attached to a pyridine ring. This compound typically exhibits properties associated with both amines and alcohols, such as being polar and capable of forming hydrogen bonds, which can influence its solubility in water and organic solvents. The amino group can participate in various chemical reactions, including nucleophilic substitutions and the formation of amides, while the hydroxymethyl group can act as a reactive site for further functionalization. Additionally, 2-aminopyridine derivatives are often studied for their biological activities, including potential roles in pharmaceuticals and agrochemicals. The compound's structure allows for various isomeric forms, which can lead to different physical and chemical properties. Overall, 2-aminopyridine-3-methanol is a versatile compound with applications in synthetic chemistry and medicinal research.

Formula: C₆H₈N₂O

InChI: InChI=1/C6H8N2O/c7-6-5(4-9)2-1-3-8-6/h1-3,9H,4H2,(H2,7,8)

SMILES: c1cc(CO)c(N)nc1

Synonyms:

• 2-Amino-3-hydroxymethyl pyridine
• (2-Aminopyridin-3-yl)methanol
• (2-Amino-pyridin-3-yl)-methanol

(2-Aminopyridin-3-yl)methanol

CAS: 23612-57-9

Formula: C₆H₈N₂O

Purity: 97%

Color and Shape: Solid, Slightly pale yellow to yellow powder

Molecular weight: 124.143

Ref: 10-F067696

3-Pyridinemethanol, 2-amino-

CAS: 23612-57-9

Formula: C₆H₈N₂O

Purity: 97%

Color and Shape: Solid

Molecular weight: 124.1405

Ref: IN-DA002NWI

2-Amino-3-pyridinemethanol

CAS: 23612-57-9

Formula: C₆H₈N₂O

Purity: >96.0%(GC)

Color and Shape: Light orange to Yellow to Green powder to crystal

Molecular weight: 124.14

Ref: 3B-A2358

2-Amino-3-(hydroxymethyl)pyridine

CAS: 23612-57-9

2-Amino-3-(hydroxymethyl)pyridine

Formula: C₆H₈N₂O

Purity: ≥95%

Color and Shape: pale yellow solid

Molecular weight: 124.14g/mol

Ref: 54-OR6117