CAS 2362-10-9
:1,3-Bis(chloromethyl)-1,1,3,3-tetramethyldisiloxane
Description:
1,3-Bis(chloromethyl)-1,1,3,3-tetramethyldisiloxane is a chemical compound characterized by its siloxane backbone, which consists of silicon-oxygen bonds. This compound features two chloromethyl groups attached to the first carbon of the siloxane chain, contributing to its reactivity and potential applications in organic synthesis. The presence of tetramethyl groups enhances its hydrophobic properties and stability, making it useful in various chemical processes. It is typically a colorless to pale yellow liquid with a distinctive odor. The compound is known for its potential use in the production of silicone polymers and as an intermediate in the synthesis of other organosilicon compounds. Due to the presence of chlorine atoms, it may exhibit reactivity towards nucleophiles, making it valuable in cross-linking reactions or as a coupling agent. Safety precautions should be taken when handling this substance, as it may pose health risks through inhalation or skin contact. Proper storage and disposal methods are essential to mitigate environmental impact and ensure safety.
Formula:C6H16Cl2OSi2
InChI:InChI=1S/C6H16Cl2OSi2/c1-10(2,5-7)9-11(3,4)6-8/h5-6H2,1-4H3
InChI key:InChIKey=NBGGEWGFZUDQKZ-UHFFFAOYSA-N
SMILES:O([Si](CCl)(C)C)[Si](CCl)(C)C
Synonyms:- (Chloromethyl)([[(chloromethyl)dimethylsilyl]oxy])dimethylsilane
- 1,1,3,3-Tetramethyl-1,3-bis(chloromethyl)disiloxane
- 1,1,3,3-Tetramethyl-1,3-di(chloromethyl)disiloxane
- 1,3-Bis(chloromethyl)tetramethyl disiloxane
- 1,3-Bis(chloromethyl)tetramethyldisiloxane
- 1,3-Di(chloromethyl)-1,1,3,3-tetramethyldisiloxane
- Bis(chloromethyl)tetramethyldisiloxane
- Disiloxane, 1,3-bis(chloromethyl)-1,1,3,3-tetramethyl-
- NSC 103492
- NSC 96793
- Tetramethyl-1,3-bis(chloromethyl)disiloxane
- See more synonyms
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
1,3-Bis(chloromethyl)tetramethyldisiloxane
CAS:Formula:C6H16Cl2OSi2Purity:>98.0%(GC)Color and Shape:Colorless to Almost colorless clear liquidMolecular weight:231.26Disiloxane, 1,3-bis(chloromethyl)-1,1,3,3-tetramethyl-
CAS:Formula:C6H16Cl2OSi2Purity:95%Color and Shape:LiquidMolecular weight:231.26761,3-Bis(chloromethyl)-1,1,3,3-tetramethyldisiloxane
CAS:1,3-Bis(chloromethyl)-1,1,3,3-tetramethyldisiloxaneFormula:C6H16Cl2OSi2Purity:95%Color and Shape: colourless liquidMolecular weight:231.27g/mol1,3-Bis(chloromethyl)tetramethyldisiloxane
CAS:S01450 - 1,3-Bis(chloromethyl)tetramethyldisiloxane
Formula:C6H16Cl2OSi2Purity:95%Color and Shape:Liquid, ClearMolecular weight:231.261,3-Bis(chloromethyl)tetramethyldisiloxane
CAS:1,3-Bis(chloromethyl)tetramethyldisiloxane is a reaction component that is used for the synthesis of other chemicals. It has a molecular weight of 172.2 g/mol and a CAS No. of 2362-10-9. This chemical is useful as a scaffold for complex compounds or as an intermediate in the synthesis of speciality chemicals. It is also a versatile building block, which can be used to synthesize many different types of compounds. 1,3-Bis(chloromethyl)tetramethyldisiloxane has been shown to have high purity and quality due to its high reactivity and usefulness in the synthesis of organic compounds.Formula:C6H16Cl2OSi2Purity:Min. 95%Color and Shape:PowderMolecular weight:231.27 g/mol




