CAS 2362-61-0: rel-(1R,2S)-2-Phenylcyclohexanol
Description:Rel-(1R,2S)-2-Phenylcyclohexanol is an organic compound characterized by its cyclohexane ring substituted with a phenyl group and a hydroxyl group (-OH) at the second carbon. This compound exhibits chirality due to the presence of two stereogenic centers, leading to specific optical isomers. The (1R,2S) configuration indicates the spatial arrangement of the substituents around these centers, which can influence its reactivity and interactions in chemical processes. As an alcohol, it can participate in hydrogen bonding, affecting its solubility in polar solvents. The presence of the phenyl group contributes to its hydrophobic character, while the hydroxyl group enhances its polarity. This compound may be utilized in various applications, including organic synthesis and as a potential intermediate in the production of pharmaceuticals or agrochemicals. Its physical properties, such as melting point, boiling point, and density, are influenced by its molecular structure and can vary based on the specific conditions under which it is measured.
Formula:C12H16O
InChI:InChI=1/C12H16O/c13-12-9-5-4-8-11(12)10-6-2-1-3-7-10/h1-3,6-7,11-13H,4-5,8-9H2/t11-,12+/s2
InChI key:InChIKey=AAIBYZBZXNWTPP-WEUYFXHZNA-N
SMILES:OC1CCCCC1C=2C=CC=CC2
- Synonyms:
- (1R,2S)-2-phenylcyclohexanol
- (1S*,2R*)-2-Phenylcyclohexanol
- (±)-trans-2-Phenylcyclohexanol
- Cyclohexanol, 2-phenyl-, (1R,2S)-rel-
- Cyclohexanol, 2-phenyl-, trans-
- Phenylcyclohexanol
- rel-(1R,2S)-2-Phenylcyclohexanol
- trans-2-Phenyl-1-cyclohexanol
Cyclohexanol, 2-phenyl-, (1R,2S)-rel-
Ref: IN-DA002NY3
| 1g | 140.00 € | ||
| 100mg | 69.00 € | ||
| 250mg | 91.00 € |
trans-2-Phenyl-1-cyclohexanol
Ref: 3B-P1174
| 1g | 80.00 € | ||
| 5g | 272.00 € |
Ref: 54-OR928729
| 1g | 245.00 € | ||
| 5g | 700.00 € |
trans-2-Phenyl-1-cyclohexanol
Ref: 3D-CAA36261
| 50mg | 629.00 € | ||
| 500mg | 1,747.00 € |
Ref: 10-F022164
| 1g | Discontinued | Request information | |
| 5g | Discontinued | Request information |
