CAS 23624-21-7

5,7-dihydroxy-8-[2-hydroxy-5-(5-hydroxy-7-methoxy-4-oxo-4H-chromen-2-yl)phenyl]-2-(4-methoxyphenyl)-4H-chromen-4-one

Description:

The chemical substance known as 5,7-dihydroxy-8-[2-hydroxy-5-(5-hydroxy-7-methoxy-4-oxo-4H-chromen-2-yl)phenyl]-2-(4-methoxyphenyl)-4H-chromen-4-one, with the CAS number 23624-21-7, is a flavonoid compound characterized by its complex polyphenolic structure. This compound features multiple hydroxyl groups, which contribute to its potential antioxidant properties. The presence of methoxy groups enhances its solubility and may influence its biological activity. Flavonoids like this one are known for their diverse pharmacological effects, including anti-inflammatory, anticancer, and cardioprotective activities. The intricate arrangement of chromenone and phenyl moieties suggests potential interactions with various biological targets, making it a subject of interest in medicinal chemistry and natural product research. Its structural complexity may also indicate potential for various synthetic modifications, which could lead to derivatives with enhanced efficacy or selectivity in therapeutic applications. Overall, this compound exemplifies the rich chemistry of flavonoids and their potential utility in health-related applications.

Formula: C₃₂H₂₂O₁₀

InChI: InChI=1/C32H22O10/c1-39-17-6-3-15(4-7-17)26-14-25(38)31-23(36)12-22(35)29(32(31)42-26)19-9-16(5-8-20(19)33)27-13-24(37)30-21(34)10-18(40-2)11-28(30)41-27/h3-14,33-36H,1-2H3

SMILES: COc1ccc(cc1)c1cc(=O)c2c(cc(c(c3cc(ccc3O)c3cc(=O)c4c(cc(cc4o3)OC)O)c2o1)O)O

Synonyms:

• 4H-1-benzopyran-4-one, 5,7-dihydroxy-8-[2-hydroxy-5-(5-hydroxy-7-methoxy-4-oxo-4H-1-benzopyran-2-yl)phenyl]-2-(4-methoxyphenyl)-
• 5,7-Dihydroxy-8-[2-hydroxy-5-(5-hydroxy-7-methoxy-4-oxochromen-2-yl)phenyl]-2-(4-methoxyphenyl)chromen-4-one

4H-1-Benzopyran-4-one, 5,7-dihydroxy-8-[2-hydroxy-5-(5-hydroxy-7-methoxy-4-oxo-4H-1-benzopyran-2-yl)phenyl]-2-(4-methoxyphenyl)-

CAS: 23624-21-7

Formula: C₃₂H₂₂O₁₀

Purity: powder

Molecular weight: 566.5111

Ref: IN-DA002NXQ

Putraflavone

CAS: 23624-21-7

Putraflavone possesses a good antioxidant activity via its DPPH free radical scavenging.

Formula: C₃₂H₂₂O₁₀

Purity: 98%

Color and Shape: Solid

Molecular weight: 566.51

Ref: TM-TN4865

Putraflavone

CAS: 23624-21-7

Formula: C₃₂H₂₂O₁₀

Purity: 95%~99%

Color and Shape: Yellow powder

Molecular weight: 566.518

Ref: BP-SBP00215

Podocarpusflavone B

CAS: 23624-21-7

Formula: C₃₂H₂₂O₁₀

Purity: 95%~99%

Molecular weight: 566.518

Ref: BP-BP2325

Putraflavone

CAS: 23624-21-7

Putraflavone is a flavonoid compound, which is derived from the seeds of the Pongamia pinnata tree, a plant native to tropical and subtropical regions. This compound is known for its robust antioxidant activity, which functions by scavenging free radicals and reducing oxidative stress at the cellular level. Its mechanism of action involves the interruption of radical chain reactions and stabilization of reactive oxygen species, ultimately contributing to enhanced cellular resilience and protection against oxidative damage.

Formula: C₃₂H₂₂O₁₀

Purity: Min. 95%

Molecular weight: 566.5 g/mol

Ref: 3D-YAA62421