CAS 23627-61-4

Pyrrolidine, 2-(diphenylmethyl)-, hydrochloride (1:1), (2R)-

Description:

Pyrrolidine, 2-(diphenylmethyl)-, hydrochloride (1:1), (2R)-, with CAS number 23627-61-4, is a chemical compound characterized by its pyrrolidine backbone, which is a five-membered saturated nitrogen-containing ring. The compound features a diphenylmethyl group, indicating the presence of two phenyl rings attached to a central carbon atom, contributing to its hydrophobic characteristics. As a hydrochloride salt, it is typically encountered in a crystalline form, which enhances its solubility in polar solvents, particularly water. The (2R)- designation indicates the specific stereochemistry at the second carbon of the pyrrolidine ring, which can influence its biological activity and interactions. This compound may exhibit various pharmacological properties, making it of interest in medicinal chemistry and drug development. Its structural features suggest potential applications in the synthesis of more complex organic molecules or as a building block in pharmaceutical formulations. Safety and handling precautions should be observed, as with all chemical substances, due to potential toxicity or reactivity.

Formula: C₁₇H₁₉N.ClH

InChI: InChI=1S/C17H19N.ClH/c1-3-8-14(9-4-1)17(16-12-7-13-18-16)15-10-5-2-6-11-15;/h1-6,8-11,16-18H,7,12-13H2;1H/t16-;/m1./s1

InChI key: InChIKey=KTGRJTGIWVDSKZ-PKLMIRHRSA-N

SMILES: C([C@H]1CCCN1)(C2=CC=CC=C2)C3=CC=CC=C3.Cl

Pyrrolidine, 2-(diphenylMethyl)-, hydrochloride, (R)- (9CI)

CAS: 23627-61-4

Formula: C₁₇H₂₀ClN

Purity: 95%

Color and Shape: Solid

Molecular weight: 273.8004

Ref: IN-DA002NXI

(R)-(+)-2-(Diphenylmethyl)pyrrolidine HCl

Controlled Product

CAS: 23627-61-4

Please enquire for more information about (R)-(+)-2-(Diphenylmethyl)pyrrolidine HCl including the price, delivery time and more detailed product information at the technical inquiry form on this page

Formula: C₁₇H₂₀ClN

Purity: Min. 95%

Molecular weight: 273.8 g/mol

Ref: 3D-YAA62761