CAS 2363-59-9
:17β-Acetoxyandrosta-1,4-dien-3-one
Description:
17β-Acetoxyandrosta-1,4-dien-3-one, commonly known as a synthetic anabolic steroid, is characterized by its structural modifications of the androgenic steroid testosterone. It features an acetoxy group at the 17β position and a double bond between the 1 and 4 positions of the steroid nucleus, which contributes to its unique biological activity. This compound is often utilized in the field of sports medicine and bodybuilding for its anabolic properties, promoting muscle growth and enhancing physical performance. Its mechanism of action primarily involves binding to androgen receptors, leading to increased protein synthesis and muscle hypertrophy. Additionally, it may exhibit varying degrees of androgenic activity, which can influence secondary sexual characteristics. The compound is typically administered in a controlled manner due to potential side effects, including hormonal imbalances and cardiovascular risks. As with many anabolic steroids, its use is regulated in many countries, and it is often banned in competitive sports. Proper understanding of its pharmacokinetics and potential interactions with other substances is essential for safe application.
Formula:C21H28O3
InChI:InChI=1S/C21H28O3/c1-13(22)24-19-7-6-17-16-5-4-14-12-15(23)8-10-20(14,2)18(16)9-11-21(17,19)3/h8,10,12,16-19H,4-7,9,11H2,1-3H3/t16-,17-,18-,19-,20-,21-/m0/s1
InChI key:InChIKey=KPCDGGNHYODURF-PXQJOHHUSA-N
SMILES:C[C@@]12[C@@]3([C@]([C@]4([C@](C)(CC3)[C@@H](OC(C)=O)CC4)[H])(CCC1=CC(=O)C=C2)[H])[H]
Synonyms:- (17Beta)-3-Oxoandrosta-1,4-Dien-17-Yl Acetate
- (17beta)-Hydroxyandrosta-1,4-dien-3-one acetate
- (17β)-17-(Acetyloxy)androsta-1,4-dien-3-one
- 1,2-Didehydrotestosterone 17-O-acetate
- 1-Dehydrotestosterone acetate
- 17beta-Acetoxy-delta-(1,5)-androstadien-3-one
- 17β-Acetoxyandrosta-1,4-dien-3-one
- 3-Oxoandrosta-1,4-Dien-17-Yl Acetate
- Androsta-1,4-dien-3-one, 17-(acetyloxy)-, (17β)-
- Androsta-1,4-dien-3-one, 17β-hydroxy-, acetate
- Boldenone 17-acetate
- See more synonyms
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
Boldenone 17-acetate
CAS:Controlled ProductBoldenone 17-acetate is a synthetic anabolic steroid that has been used in the past to increase muscle mass and appetite. It is a prodrug that converts to boldenone, its active form, with the help of enzymes called esterases. Boldenone 17-acetate binds to the androgen receptor and exerts its effects by increasing protein synthesis, nitrogen retention, and bone density. This drug has a matrix effect that can be seen in chromatographic profiles after sample preparation. The detection time for this drug is typically less than 3 hours.Formula:C21H28O3Purity:Min. 95%Color and Shape:SolidMolecular weight:328.45 g/molBoldenone Acetate-d3
CAS:Controlled ProductFormula:C21H25D3O3Color and Shape:NeatMolecular weight:331.46

