CAS 2363-71-5
:Heneicosanoic acid
Description:
Heneicosanoic acid, also known as docosanoic acid, is a long-chain saturated fatty acid with the chemical formula C21H42O2. It is characterized by a straight-chain structure consisting of 21 carbon atoms and a carboxylic acid functional group (-COOH) at one end. This fatty acid is typically found in various natural fats and oils, particularly in some animal fats and plant oils. Heneicosanoic acid is a waxy solid at room temperature and is insoluble in water due to its long hydrophobic carbon chain, but it is soluble in organic solvents such as ethanol and chloroform. Its melting point is relatively high compared to shorter-chain fatty acids, reflecting its saturated nature. Heneicosanoic acid can be used in various applications, including the production of surfactants, lubricants, and as a potential biofuel. Additionally, it may have implications in biochemistry and nutrition, particularly in studies related to fatty acid metabolism and health.
Formula:C21H42O2
InChI:InChI=1S/C21H42O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21(22)23/h2-20H2,1H3,(H,22,23)
InChI key:InChIKey=CKDDRHZIAZRDBW-UHFFFAOYSA-N
SMILES:C(CCCCCCCCCCCCC)CCCCCCC(O)=O
Synonyms:- Acide Henicosanoique
- Acido Henicosanoico
- Heneicosylic acid
- Henicosanoic Acid
- Henicosansaure
- n-Heneicosanoic acid
- Heneicosanoic acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 12 products.
Heneicosanoic Acid
CAS:Formula:C21H42O2Purity:>98.0%(GC)(T)Color and Shape:White to Almost white powder to crystalMolecular weight:326.57Henicosanoic Acid
CAS:Henicosanoic AcidFormula:C21H42O2Purity:98%Color and Shape:SolidMolecular weight:326.56Heneicosanoic acid
CAS:Heneicosanoic acidFormula:C21H42O2Purity:≥95%Color and Shape:SolidMolecular weight:326.56Heneicosanoic acid (Standard)
CAS:Heneicosanoic acid (Standard) is the standard substance of Heneicosanoic acid, and it is applicable for quantitative analysis, quality control, and related research in biochemical experiments. Heneicosanoic acid (C21:0) (HEA) is a fatty acid found in human milk fat. HEA is also a part of the phospholipids of the articular cartilage boundary lubricant. HEA is a constituent of red blood cell fatty acids.Formula:C21H42O2Color and Shape:SolidMolecular weight:326.56Heneicosanoic acid
CAS:HEA (C21:0), a fatty acid in human milk and red blood cells, lubricates joint cartilage.Formula:C21H42O2Purity:97.87% - 99.52%Color and Shape:SolidMolecular weight:326.56









