CAS 2363-84-0
:2-oxohexanal
Description:
2-Oxohexanal, also known as hexanal-2-one, is an organic compound characterized by its aldehyde functional group and a ketone group, making it a member of the α-keto aldehyde family. It has a six-carbon chain, with the carbonyl groups located at the second and terminal positions. This compound is typically a colorless to pale yellow liquid with a distinctive odor, often described as fatty or waxy. It is soluble in organic solvents and exhibits moderate solubility in water due to its polar functional groups. 2-Oxohexanal can participate in various chemical reactions, including condensation and oxidation, making it useful in organic synthesis and as an intermediate in the production of other chemicals. Its reactivity is influenced by the presence of both the aldehyde and ketone functionalities, allowing it to engage in diverse chemical transformations. Additionally, it may have applications in flavoring and fragrance industries, as well as in the synthesis of pharmaceuticals and agrochemicals. Safety precautions should be observed when handling this compound, as it may pose health risks if inhaled or ingested.
Formula:C6H10O2
InChI:InChI=1/C6H10O2/c1-2-3-4-6(8)5-7/h5H,2-4H2,1H3
SMILES:CCCCC(=O)C=O
Synonyms:- Hexanal, 2-oxo-
- 2-Oxohexanal
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
