CAS 23635-30-5
:N-tfa-L-phenylalanine methyl ester
Description:
N-tfa-L-phenylalanine methyl ester, with the CAS number 23635-30-5, is a derivative of the amino acid phenylalanine, modified to include a trifluoroacetyl (tfa) group and a methyl ester functionality. This compound typically appears as a white to off-white solid and is soluble in organic solvents such as methanol and dichloromethane, but has limited solubility in water due to its hydrophobic characteristics. The trifluoroacetyl group enhances the compound's stability and can influence its reactivity, making it useful in various synthetic applications, particularly in peptide synthesis and drug development. The methyl ester form allows for easier handling and incorporation into larger molecular frameworks. Additionally, the presence of the phenyl group contributes to its aromatic properties, which can affect its interactions in biological systems. As with many chemical substances, proper handling and safety precautions are essential, as the trifluoroacetyl group can pose hazards. Overall, N-tfa-L-phenylalanine methyl ester serves as a valuable intermediate in organic synthesis and pharmaceutical research.
Formula:C12H12F3NO3
InChI:InChI=1/C12H12F3NO3/c1-19-10(17)9(16-11(18)12(13,14)15)7-8-5-3-2-4-6-8/h2-6,9H,7H2,1H3,(H,16,18)
SMILES:COC(=O)C(Cc1ccccc1)N=C(C(F)(F)F)O
Synonyms:- methyl N-(trifluoroacetyl)phenylalaninate
- Tfa-Phe-Ome
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
(S)-Methyl 3-phenyl-2-(2,2,2-trifluoroacetamido)propanoate
CAS:Formula:C12H12F3NO3Molecular weight:275.2238
