CAS 236389-21-2: 9,9'-spirobi[fluoren]-2-ylboronic acid
Description:9,9'-Spirobi[fluoren]-2-ylboronic acid is an organoboron compound characterized by its unique spirobifluorene structure, which consists of two fluorene units connected by a boronic acid functional group. This compound typically exhibits properties such as good solubility in organic solvents and the ability to form reversible covalent bonds with diols, making it useful in various applications, including organic synthesis and materials science. The presence of the boronic acid group allows for participation in Suzuki-Miyaura cross-coupling reactions, which are pivotal in the formation of carbon-carbon bonds. Additionally, the spiro structure contributes to its rigidity and potential for π-π stacking interactions, which can influence its electronic properties. This compound may also exhibit fluorescence, making it of interest in optoelectronic applications. Overall, 9,9'-spirobi[fluoren]-2-ylboronic acid is a versatile building block in organic chemistry, particularly in the development of functional materials and molecular devices.
Formula:C25H17BO2
InChI:InChI=1/C25H17BO2/c27-26(28)16-13-14-20-19-9-3-6-12-23(19)25(24(20)15-16)21-10-4-1-7-17(21)18-8-2-5-11-22(18)25/h1-15,27-28H
- Synonyms:
- boronic acid, B-9,9'-spirobi[9H-fluoren]-2-yl-
- B-9,9'-Spirobi[9H-fluoren]-2'-yl-boronic acid
- 9,9'-Spirobi[9H-fluorene]-2-boronic Acid
- 9,9'-Spirobi[9H-fluoren]-2-yl-boronic acid

9,9'-Spirobifluorene-2-boronic acid, 98%
Ref: 02-H64525
1g | To inquire | ||
5g | To inquire |

Boronic acid, B-9,9'-spirobi[9H-fluoren]-2-yl-
Ref: IN-DA002NYV
1g | 42.00 € | ||
5g | 107.00 € | ||
25g | 236.00 € | ||
100g | 647.00 € | ||
250mg | 28.00 € |

9,9'-Spirobi[9H-fluorene]-2-boronic Acid
Ref: 3B-S0831
1g | 75.00 € | ||
5g | 213.00 € |

9,9'-Spirobi[fluoren]-2-ylboronic acid
Ref: 10-F222170
1g | 25.00 € | ||
5g | 117.00 € | ||
10g | 133.00 € | ||
25g | 351.00 € | ||
100g | 663.00 € |

Ref: 54-OR315391
1g | 32.00 € | ||
5g | 95.00 € | ||
25g | 269.00 € | ||
100g | 508.00 € |

9,9'-Spirobi[9H-fluorene]-2-boronic Acid
Ref: 3D-FS62383
1g | Discontinued | Request information | |
2g | Discontinued | Request information | |
5g | Discontinued | Request information | |
250mg | Discontinued | Request information | |
500mg | Discontinued | Request information |