CAS 236389-21-2
:9,9'-spirobi[fluoren]-2-ylboronic acid
Description:
9,9'-Spirobi[fluoren]-2-ylboronic acid is an organoboron compound characterized by its unique spirobifluorene structure, which consists of two fluorene units connected by a boronic acid functional group. This compound typically exhibits properties such as good solubility in organic solvents and the ability to form reversible covalent bonds with diols, making it useful in various applications, including organic synthesis and materials science. The presence of the boronic acid group allows for participation in Suzuki-Miyaura cross-coupling reactions, which are pivotal in the formation of carbon-carbon bonds. Additionally, the spiro structure contributes to its rigidity and potential for π-π stacking interactions, which can influence its electronic properties. This compound may also exhibit fluorescence, making it of interest in optoelectronic applications. Overall, 9,9'-spirobi[fluoren]-2-ylboronic acid is a versatile building block in organic chemistry, particularly in the development of functional materials and molecular devices.
Formula:C25H17BO2
InChI:InChI=1/C25H17BO2/c27-26(28)16-13-14-20-19-9-3-6-12-23(19)25(24(20)15-16)21-10-4-1-7-17(21)18-8-2-5-11-22(18)25/h1-15,27-28H
SMILES:c1ccc2c(c1)c1ccccc1C12c2ccccc2c2ccc(cc12)B(O)O
Synonyms:- boronic acid, B-9,9'-spirobi[9H-fluoren]-2-yl-
- B-9,9'-Spirobi[9H-fluoren]-2'-yl-boronic acid
- 9,9'-Spirobi[9H-fluorene]-2-boronic Acid
- 9,9'-Spirobi[9H-fluoren]-2-yl-boronic acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
9,9'-Spirobifluorene-2-boronic acid, 98%
CAS:This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo SciFormula:C25H17BO2Purity:98%Molecular weight:360.22Boronic acid, B-9,9'-spirobi[9H-fluoren]-2-yl-
CAS:Formula:C25H17BO2Purity:97%Color and Shape:SolidMolecular weight:360.21239,9'-Spirobi[fluoren]-2-ylboronic acid
CAS:9,9'-Spirobi[fluoren]-2-ylboronic acidPurity:98%Molecular weight:360.21g/mol9,9'-Spirobi[9H-fluorene]-2-boronic Acid
CAS:Formula:C25H17BO2Purity:95.0 to 105.0 %Color and Shape:White to Almost white powder to crystalMolecular weight:360.229,9′-Spirobi[fluoren]-2-ylboronic acid
CAS:Formula:C25H17BO2Purity:95%Color and Shape:Liquid, No data available.Molecular weight:360.22




