CAS 236406-29-4
:1,1-Dimethylethyl N-[(4-ethyl-4-piperidinyl)methyl]carbamate
Description:
1,1-Dimethylethyl N-[(4-ethyl-4-piperidinyl)methyl]carbamate, identified by its CAS number 236406-29-4, is a chemical compound that belongs to the class of carbamates. This substance features a carbamate functional group, which is characterized by the presence of a carbonyl group (C=O) bonded to a nitrogen atom (N) that is also connected to an alkyl or aryl group. The compound exhibits a complex structure due to the presence of a piperidine ring, which contributes to its potential biological activity. Typically, carbamates can act as insecticides, herbicides, or pharmaceuticals, depending on their specific structure and substituents. The presence of the dimethyl group suggests steric hindrance, which may influence its reactivity and interaction with biological targets. Additionally, the ethyl substitution on the piperidine ring may enhance lipophilicity, affecting the compound's solubility and permeability in biological systems. Overall, this compound's unique structure may confer specific properties that are of interest in various fields, including medicinal chemistry and agrochemicals.
Formula:C13H26N2O2
InChI:InChI=1S/C13H26N2O2/c1-5-13(6-8-14-9-7-13)10-15-11(16)17-12(2,3)4/h14H,5-10H2,1-4H3,(H,15,16)
InChI key:InChIKey=GSGAKGVYNPGZSG-UHFFFAOYSA-N
SMILES:C(NC(OC(C)(C)C)=O)C1(CC)CCNCC1
Synonyms:- 1,1-Dimethylethyl N-[(4-ethyl-4-piperidinyl)methyl]carbamate
- Carbamic acid, [(4-ethyl-4-piperidinyl)methyl]-, 1,1-dimethylethyl ester
- Carbamic acid, N-[(4-ethyl-4-piperidinyl)methyl]-, 1,1-dimethylethyl ester
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
tert-Butyl (4-ethylpiperidin-4-yl)methylcarbamate
CAS:Formula:C13H26N2O2Color and Shape:SolidMolecular weight:242.363
