CAS 236406-61-4
:tert-butyl 2,7-diazaspiro[4.5]decane-7-carboxylate
Description:
Tert-butyl 2,7-diazaspiro[4.5]decane-7-carboxylate is a chemical compound characterized by its unique spirocyclic structure, which includes a bicyclic framework containing nitrogen atoms. This compound features a tert-butyl ester functional group, contributing to its solubility and reactivity. The presence of the diaza moiety indicates that it contains two nitrogen atoms within its structure, which can influence its chemical behavior, including potential interactions with biological systems. The spirocyclic nature of the compound often imparts interesting conformational properties, making it a subject of interest in medicinal chemistry and drug design. Additionally, the carboxylate group can participate in various chemical reactions, such as esterification and amidation, enhancing its versatility in synthetic applications. Overall, tert-butyl 2,7-diazaspiro[4.5]decane-7-carboxylate is notable for its structural complexity and potential utility in various chemical and pharmaceutical contexts.
Formula:C13H24N2O2
InChI:InChI=1/C13H24N2O2/c1-12(2,3)17-11(16)15-8-4-5-13(10-15)6-7-14-9-13/h14H,4-10H2,1-3H3
SMILES:CC(C)(C)OC(=O)N1CCCC2(CCNC2)C1
Synonyms:- 2,7-Diazaspiro[4.5]decane-7-carboxylic acid t-butyl ester
- tert-Butyl-2,7-diazaspiro[4.5]decan-7-carboxylat
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
2,7-Diazaspiro[4.5]decane-7-carboxylic acid, 1,1-dimethylethyl ester
CAS:Formula:C13H24N2O2Purity:95%Color and Shape:LiquidMolecular weight:240.3419tert-Butyl 2,7-diazaspiro[4.5]decane-7-carboxylate
CAS:tert-Butyl 2,7-diazaspiro[4.5]decane-7-carboxylatePurity:97%Molecular weight:240.34g/mol7-Boc-2,7-Diazaspiro[4.5]decane
CAS:Formula:C13H24N2O2Purity:95%Color and Shape:LiquidMolecular weight:240.3472,7-Diazaspiro[4.5]decane-7-carboxylic acid tert-butyl ester
CAS:<p>2,7-Diazaspiro[4.5]decane-7-carboxylic acid tert-butyl ester is a polycarboxylic acid that is used as a pharmaceutical preparation. It has optical properties and is used in animal experiments to study inflammatory diseases. 2,7-Diazaspiro[4.5]decane-7-carboxylic acid tert-butyl ester has been shown to be effective in the treatment of hydrochloric acid induced ulcers in rats by reducing the amount of fatty acids and phospholipids present in the stomach lining and increasing the level of prostaglandin E2 (PGE2) production. It also works as a cross linking agent for chloride ion with fatty acids or esters to form an insoluble compound. The 2,7 diazaspiro[4.5]decane-7 carboxylic acid tert butyl ester is soluble in organic solv</p>Formula:C13H24N2O2Purity:Min. 95%Molecular weight:240.34 g/mol



