CAS 236406-61-4

tert-butyl 2,7-diazaspiro[4.5]decane-7-carboxylate

Description:

Tert-butyl 2,7-diazaspiro[4.5]decane-7-carboxylate is a chemical compound characterized by its unique spirocyclic structure, which includes a bicyclic framework containing nitrogen atoms. This compound features a tert-butyl ester functional group, contributing to its solubility and reactivity. The presence of the diaza moiety indicates that it contains two nitrogen atoms within its structure, which can influence its chemical behavior, including potential interactions with biological systems. The spirocyclic nature of the compound often imparts interesting conformational properties, making it a subject of interest in medicinal chemistry and drug design. Additionally, the carboxylate group can participate in various chemical reactions, such as esterification and amidation, enhancing its versatility in synthetic applications. Overall, tert-butyl 2,7-diazaspiro[4.5]decane-7-carboxylate is notable for its structural complexity and potential utility in various chemical and pharmaceutical contexts.

Formula: C₁₃H₂₄N₂O₂

InChI: InChI=1/C13H24N2O2/c1-12(2,3)17-11(16)15-8-4-5-13(10-15)6-7-14-9-13/h14H,4-10H2,1-3H3

SMILES: CC(C)(C)OC(=O)N1CCCC2(CCNC2)C1

Synonyms:

• 2,7-Diazaspiro[4.5]decane-7-carboxylic acid t-butyl ester
• tert-Butyl-2,7-diazaspiro[4.5]decan-7-carboxylat

2,7-Diazaspiro[4.5]decane-7-carboxylic acid, 1,1-dimethylethyl ester

CAS: 236406-61-4

Formula: C₁₃H₂₄N₂O₂

Purity: 97%

Color and Shape: Liquid

Molecular weight: 240.3419

Ref: IN-DA002O0F

tert-Butyl 2,7-diazaspiro[4.5]decane-7-carboxylate

CAS: 236406-61-4

tert-Butyl 2,7-diazaspiro[4.5]decane-7-carboxylate

Purity: 97%

Molecular weight: 240.34g/mol

Ref: 54-OR312326

7-Boc-2,7-Diazaspiro[4.5]decane

CAS: 236406-61-4

Formula: C₁₃H₂₄N₂O₂

Purity: 95%

Color and Shape: Liquid

Molecular weight: 240.347

Ref: 10-F236640

2,7-Diazaspiro[4.5]decane-7-carboxylic acid tert-butyl ester

CAS: 236406-61-4

2,7-Diazaspiro[4.5]decane-7-carboxylic acid tert-butyl ester is a polycarboxylic acid that is used as a pharmaceutical preparation. It has optical properties and is used in animal experiments to study inflammatory diseases. 2,7-Diazaspiro[4.5]decane-7-carboxylic acid tert-butyl ester has been shown to be effective in the treatment of hydrochloric acid induced ulcers in rats by reducing the amount of fatty acids and phospholipids present in the stomach lining and increasing the level of prostaglandin E2 (PGE2) production. It also works as a cross linking agent for chloride ion with fatty acids or esters to form an insoluble compound. The 2,7 diazaspiro[4.5]decane-7 carboxylic acid tert butyl ester is soluble in organic solv

Formula: C₁₃H₂₄N₂O₂

Purity: Min. 95%

Molecular weight: 240.34 g/mol

Ref: 3D-LJA40661