CAS 23643-38-1

Uridine, 5-fluoro-2′-C-methyl-

Description:

Uridine, 5-fluoro-2′-C-methyl- is a nucleoside analog characterized by the presence of a fluorine atom at the 5-position of the uracil base and a methyl group at the 2′ position of the ribose sugar. This modification can influence its biological activity and stability. The compound is known for its potential antiviral properties, particularly against certain RNA viruses, as it can interfere with viral replication processes. Its structure allows it to mimic natural nucleosides, which can be incorporated into RNA during synthesis, potentially leading to the production of defective viral proteins. The presence of the fluorine atom enhances its metabolic stability compared to unmodified uridine. Additionally, this compound may exhibit unique pharmacokinetic properties, influencing its absorption, distribution, metabolism, and excretion in biological systems. As a research chemical, it is often studied for its therapeutic potential and mechanisms of action in virology and molecular biology.

Formula: C₁₀H₁₃FN₂O₆

InChI: InChI=1S/C10H13FN2O6/c1-10(18)6(15)5(3-14)19-8(10)13-2-4(11)7(16)12-9(13)17/h2,5-6,8,14-15,18H,3H2,1H3,(H,12,16,17)/t5-,6-,8-,10-/m1/s1

InChI key: InChIKey=JJGOHYAJPJNPOC-LTNPLRIYSA-N

SMILES: C[C@]1(O)[C@@H](O[C@H](CO)[C@H]1O)N2C(=O)NC(=O)C(F)=C2

Synonyms:

• Uridine, 5-fluoro-2′-C-methyl-

2'-C-methyl-5-fluorouriddine

CAS: 23643-38-1

Nucleosides and Reagents - Fluoro-modified nucleoside; 2’-C-methyl nucleoside; ; 5-Modified pyrimidine nucleoside

Formula: C₁₀H₁₃FN₂O₆

Color and Shape: Solid

Molecular weight: 276.22

Ref: TM-TNU0138

2’-C-Methyl-5-fluorouridine

CAS: 23643-38-1

2’-C-Methyl-5-fluorouridine is a fine chemical that is used as a versatile building block for the synthesis of various complex compounds. It is also used as a reaction component in the synthesis of research chemicals and speciality chemicals. 2’-C-Methyl-5-fluorouridine is an important intermediate in organic chemistry and has many applications, such as being a reaction component in the synthesis of pharmaceuticals, agrochemicals, dyes, and perfumes.

Formula: C₁₀H₁₃FN₂O₆

Purity: Min. 95%

Color and Shape: Solid

Molecular weight: 276.22 g/mol

Ref: 3D-FM144517