CAS 2365-43-7
:9H-Purine-6-carboxylic acid
Description:
9H-Purine-6-carboxylic acid, also known as uric acid, is a heterocyclic organic compound that plays a significant role in the metabolism of purines in the body. It is characterized by its bicyclic structure, which consists of a fused imidazole and pyrimidine ring, with a carboxylic acid functional group at the 6-position. This compound is typically found in the form of a white crystalline solid and is soluble in water, particularly at higher temperatures. Uric acid is a product of purine degradation and is primarily excreted in urine, making it an important biomarker for various metabolic disorders, including gout and kidney stones. Its physiological role includes acting as an antioxidant, although elevated levels can lead to health issues. The compound has a relatively low pKa, indicating that it can exist in both protonated and deprotonated forms depending on the pH of the environment. Overall, 9H-Purine-6-carboxylic acid is a crucial substance in biochemistry, with implications for human health and disease.
Formula:C6H4N4O2
InChI:InChI=1S/C6H4N4O2/c11-6(12)4-3-5(9-1-7-3)10-2-8-4/h1-2H,(H,11,12)(H,7,8,9,10)
InChI key:InChIKey=CIEQXUBLKKQRIS-UHFFFAOYSA-N
SMILES:C(O)(=O)C1=C2C(N=CN2)=NC=N1
Synonyms:- 5H-purine-6-carboxylic acid
- 6-Carboxypurine
- 6-Purinoic acid
- 7H-purine-6-carboxylic acid
- 9H-Purine-6-carboxylic acid
- NSC 54461
- Purine-6-carboxylic acid
- 1H-Purine-6-carboxylic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
