CAS 23654-92-4
:3,5-Dimethyl-1,2,4-trithiolane
Description:
3,5-Dimethyl-1,2,4-trithiolane is a heterocyclic organic compound characterized by a five-membered ring containing three sulfur atoms and two carbon atoms, with additional methyl groups at the 3 and 5 positions. This compound is part of the class of thioethers and is known for its distinctive sulfur-containing structure, which contributes to its unique chemical properties. It typically exhibits a relatively low boiling point and is soluble in organic solvents. The presence of sulfur atoms in the ring can impart reactivity, particularly in nucleophilic substitution reactions, and can influence the compound's stability and reactivity under various conditions. Additionally, 3,5-Dimethyl-1,2,4-trithiolane may exhibit interesting biological activities, making it of interest in various fields, including medicinal chemistry and materials science. Its CAS number, 23654-92-4, allows for easy identification and reference in chemical databases and literature. Overall, this compound's unique structure and properties make it a subject of interest for further research and application.
Formula:C4H8S3
InChI:InChI=1S/C4H8S3/c1-3-5-4(2)7-6-3/h3-4H,1-2H3
InChI key:InChIKey=HFRUNLRFNNTTPQ-UHFFFAOYSA-N
SMILES:CC1SC(C)SS1
Synonyms:- 1,2,4-Trithiolane, 3,5-dimethyl-
- 2,5-Dimethyl-1,3,4-trithiolane
- FEMA No. 3541
- 3,5-Dimethyl-1,2,4-trithiolane
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.

