CAS 23656-74-8

N-(furan-2-ylmethyl)-1-phenylpropan-2-amine

Description:

N-(furan-2-ylmethyl)-1-phenylpropan-2-amine, also known by its CAS number 23656-74-8, is a chemical compound that belongs to the class of substituted phenethylamines. This substance features a furan ring, which is a five-membered aromatic heterocycle containing oxygen, attached to a phenylpropan-2-amine backbone. The presence of both the furan and phenyl groups contributes to its unique chemical properties, including potential interactions with neurotransmitter systems. The compound may exhibit psychoactive effects, similar to other amines, due to its structural similarity to known stimulants. Its molecular structure suggests it could participate in various chemical reactions, including alkylation and substitution, making it of interest in medicinal chemistry and drug development. Additionally, the compound's solubility, stability, and reactivity can vary based on environmental conditions such as pH and temperature. As with many organic compounds, safety and handling precautions are essential, as the biological effects and toxicity profiles of such substances can vary significantly.

Formula: C₁₄H₁₇NO

InChI: InChI=1/C14H17NO/c1-12(10-13-6-3-2-4-7-13)15-11-14-8-5-9-16-14/h2-9,12,15H,10-11H2,1H3

SMILES: CC(Cc1ccccc1)NCc1ccco1

N-(furan-2-ylmethyl)-1-phenylpropan-2-amine

CAS: 23656-74-8

Purity: 98%

Molecular weight: 215.2960052

Ref: 10-F753605

Amphetamine-N-(2-furanmethyl)

Controlled Product

CAS: 23656-74-8

Applications Amphetamine-N-(2-furanmethyl) is the impurity of DL-Amphetamine (A010300)(CAS#300-62-9) , which is a psychoactive drug of abuse which can be detected in urine samples and oral fluids of users by mass spectrometric methods.
References Li, Y., et al.: Fenxi Shiyanshi , 34, 1072 (2015);Morato, N. et al.: Anal. Chem., 91, 7450 (2019);

Formula: C₁₄H₁₇NO

Color and Shape: Neat

Molecular weight: 215.29

Ref: TR-A110320