CAS 23661-37-2
:Triacetyl α-cyclodextrin
Description:
Triacetyl α-cyclodextrin is a modified derivative of α-cyclodextrin, which is a cyclic oligosaccharide composed of six glucose units. This compound is characterized by the acetylation of its hydroxyl groups, enhancing its lipophilicity and solubility in organic solvents compared to its parent compound. Triacetyl α-cyclodextrin exhibits a unique ability to form inclusion complexes with various hydrophobic molecules, making it valuable in pharmaceutical and food applications for improving the solubility and stability of active ingredients. Its molecular structure allows it to encapsulate guest molecules within its hydrophobic cavity, facilitating controlled release and enhancing bioavailability. Additionally, it is generally recognized as safe (GRAS) for use in food products, and its biocompatibility makes it suitable for drug delivery systems. The compound is typically white to off-white in appearance and is soluble in organic solvents while being less soluble in water. Overall, triacetyl α-cyclodextrin serves as an important tool in various fields, including drug formulation, food technology, and analytical chemistry.
Formula:C72H96O48
InChI:InChI=1S/C72H96O48/c1-25(73)91-19-43-49-55(97-31(7)79)61(103-37(13)85)67(109-43)116-50-44(20-92-26(2)74)111-69(63(105-39(15)87)56(50)98-32(8)80)118-52-46(22-94-28(4)76)113-71(65(107-41(17)89)58(52)100-34(10)82)120-54-48(24-96-30(6)78)114-72(66(108-42(18)90)60(54)102-36(12)84)119-53-47(23-95-29(5)77)112-70(64(106-40(16)88)59(53)101-35(11)83)117-51-45(21-93-27(3)75)110-68(115-49)62(104-38(14)86)57(51)99-33(9)81/h43-72H,19-24H2,1-18H3/t43-,44-,45-,46-,47-,48-,49-,50-,51-,52-,53-,54-,55+,56+,57+,58+,59+,60+,61-,62-,63-,64-,65-,66-,67-,68-,69-,70-,71-,72-/m1/s1
InChI key:InChIKey=WPCDNMKUJVKODC-WLPBKHADSA-N
SMILES:O(C(C)=O)[C@H]1[C@]2([C@@H](COC(C)=O)O[C@@]([C@@H]1OC(C)=O)(O[C@]3([C@H](OC(C)=O)[C@@H](OC(C)=O)[C@](O[C@@H]3COC(C)=O)(O[C@]4([C@H](OC(C)=O)[C@@H](OC(C)=O)[C@](O[C@@H]4COC(C)=O)(O[C@]5([C@H](OC(C)=O)[C@@H](OC(C)=O)[C@@](O[C@]6([C@H](OC(C)=O)[C@@H](OC(C)=O)[C@@](O[C@]7([C@H](OC(C)=O)[C@@H](OC(C)=O)[C@@](O2)(O[C@@H]7COC(C)=O)[H])[H])(O[C@@H]6COC(C)=O)[H])[H])(O[C@@H]5COC(C)=O)[H])[H])[H])[H])[H])[H])[H])[H]
Synonyms:- Peracetylated α-cyclodextrin
- α-Cyclodextrin peracetate
- 2,4,7,9,12,14,17,19,22,24,27,29-Dodecaoxaheptacyclo[26.2.2.23,6.28,11.213,16.218,21.223,26]dotetracontane, α-cyclodextrin deriv.
- α-Cyclodextrin, 2A,2B,2C,2D,2E,2F,3A,3B,3C,3D,3E,3F,6A,6B,6C,6D,6E,6F-octadecaacetate
- α-Cyclodextrin, octadecaacetate
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 1 products.
a-Cyclodextrin octadecaacetate
CAS:Alpha-cyclodextrin (α-CD) derivative with a hydrophilic exterior and lipophilic cavity (smaller than β-CDs and γ-CDs) to allocate certain guest molecules. This structural characteristic enables applications in molecular encapsulation, solubility enhancement, and stabilization across multiple industries. In pharmaceuticals, it serves as a drug delivery vehicle, enhancing the bioavailability and stability of active ingredients. The food industry utilizes it as a stabilizer for flavors, colors, and nutrients, as well as a functional ingredient for its effects on lipid metabolism. In cosmetics, it acts as a complex agent for fragrances and active components. Its applications extend to analytical chemistry for chiral separation and to materials science for developing smart materials and nanosystems.Formula:C72H96O48Purity:Min. 95%Molecular weight:1,729.5 g/mol
