CAS 23661-37-2: Triacetyl α-cyclodextrin

Description:Triacetyl α-cyclodextrin is a modified derivative of α-cyclodextrin, which is a cyclic oligosaccharide composed of six glucose units. This compound is characterized by the acetylation of its hydroxyl groups, enhancing its lipophilicity and solubility in organic solvents compared to its parent compound. Triacetyl α-cyclodextrin exhibits a unique ability to form inclusion complexes with various hydrophobic molecules, making it valuable in pharmaceutical and food applications for improving the solubility and stability of active ingredients. Its molecular structure allows it to encapsulate guest molecules within its hydrophobic cavity, facilitating controlled release and enhancing bioavailability. Additionally, it is generally recognized as safe (GRAS) for use in food products, and its biocompatibility makes it suitable for drug delivery systems. The compound is typically white to off-white in appearance and is soluble in organic solvents while being less soluble in water. Overall, triacetyl α-cyclodextrin serves as an important tool in various fields, including drug formulation, food technology, and analytical chemistry.

Formula:C₇₂H₉₆O₄₈

InChI:InChI=1S/C72H96O48/c1-25(73)91-19-43-49-55(97-31(7)79)61(103-37(13)85)67(109-43)116-50-44(20-92-26(2)74)111-69(63(105-39(15)87)56(50)98-32(8)80)118-52-46(22-94-28(4)76)113-71(65(107-41(17)89)58(52)100-34(10)82)120-54-48(24-96-30(6)78)114-72(66(108-42(18)90)60(54)102-36(12)84)119-53-47(23-95-29(5)77)112-70(64(106-40(16)88)59(53)101-35(11)83)117-51-45(21-93-27(3)75)110-68(115-49)62(104-38(14)86)57(51)99-33(9)81/h43-72H,19-24H2,1-18H3/t43-,44-,45-,46-,47-,48-,49-,50-,51-,52-,53-,54-,55+,56+,57+,58+,59+,60+,61-,62-,63-,64-,65-,66-,67-,68-,69-,70-,71-,72-/m1/s1

InChI key:InChIKey=WPCDNMKUJVKODC-WLPBKHADSA-N

SMILES:O=C(OCC1OC2OC3C(OC(OC4C(OC(OC5C(OC(OC6C(OC(OC7C(OC(OC1C(OC(=O)C)C2OC(=O)C)C(OC(=O)C)C7OC(=O)C)COC(=O)C)C(OC(=O)C)C6OC(=O)C)COC(=O)C)C(OC(=O)C)C5OC(=O)C)COC(=O)C)C(OC(=O)C)C4OC(=O)C)COC(=O)C)C(OC(=O)C)C3OC(=O)C)COC(=O)C)C

Synonyms:
Peracetylated α-cyclodextrin
α-Cyclodextrin peracetate
2,4,7,9,12,14,17,19,22,24,27,29-Dodecaoxaheptacyclo[26.2.2.23,6.28,11.213,16.218,21.223,26]dotetracontane, α-cyclodextrin deriv.
α-Cyclodextrin, 2A,2B,2C,2D,2E,2F,3A,3B,3C,3D,3E,3F,6A,6B,6C,6D,6E,6F-octadecaacetate
α-Cyclodextrin, octadecaacetate