CAS 23665-96-5

Neogrifolin

Description:

Neogrifolin is a naturally occurring chemical compound classified as a sesquiterpene, primarily derived from certain plant species, particularly those in the Asteraceae family. It is known for its complex molecular structure, which contributes to its diverse biological activities. Neogrifolin exhibits various pharmacological properties, including anti-inflammatory, antimicrobial, and potential anticancer effects, making it a subject of interest in medicinal chemistry and pharmacology. The compound's mechanism of action often involves modulation of cellular pathways, although specific details may vary based on the biological context. Neogrifolin is typically studied in the context of natural product chemistry, where its extraction, purification, and synthesis are explored for potential therapeutic applications. Its CAS number, 23665-96-5, serves as a unique identifier for researchers and regulatory bodies to facilitate the tracking and study of this compound in scientific literature and databases. Overall, Neogrifolin represents a promising area of research in the quest for new therapeutic agents derived from natural sources.

Formula: C₂₂H₃₂O₂

InChI: InChI=1S/C22H32O2/c1-16(2)8-6-9-17(3)10-7-11-18(4)12-13-21-19(5)14-20(23)15-22(21)24/h8,10,12,14-15,23-24H,6-7,9,11,13H2,1-5H3/b17-10+,18-12+

InChI key: InChIKey=JWDIUXFSIWOGDP-VZRGJMDUSA-N

SMILES: C(/C=C(/CC/C=C(/CCC=C(C)C)\C)\C)C1=C(C)C=C(O)C=C1O

Synonyms:

• 5-Methyl-4-[(2E,6E)-3,7,11-trimethyl-2,6,10-dodecatrien-1-yl]-1,3-benzenediol
• 1,3-Benzenediol, 5-methyl-4-[(2E,6E)-3,7,11-trimethyl-2,6,10-dodecatrienyl]-
• 1,3-Benzenediol, 5-methyl-4-[(2E,6E)-3,7,11-trimethyl-2,6,10-dodecatrien-1-yl]-
• Resorcinol, 5-methyl-4-(3,7,11-trimethyl-2,6,10-dodecatrienyl)-, (E,E)-
• 1,3-Benzenediol, 5-methyl-4-(3,7,11-trimethyl-2,6,10-dodecatrienyl)-, (E,E)-

1,3-Benzenediol, 5-methyl-4-[(2E,6E)-3,7,11-trimethyl-2,6,10-dodecatrien-1-yl]-

CAS: 23665-96-5

Formula: C₂₂H₃₂O₂

Purity: 98.5%

Color and Shape: Solid

Molecular weight: 328.4883

Ref: IN-DA01S7IN

Neogrifolin

CAS: 23665-96-5

Neogrifolin is a potential candidate for osteosarcoma, it can induce concentration- and time-dependent suppression of proliferation and induce apoptosis in U2OS

Formula: C₂₂H₃₂O₂

Purity: 98%

Color and Shape: Solid

Molecular weight: 328.49

Ref: TM-TN4637

Neogrifolin

CAS: 23665-96-5

Neogrifolin is a natural product, specifically a bioactive compound, which is derived from certain species of fungi, such as those in the Polyporaceae family. It is recognized for its diverse range of bioactivities that arise from its role as a secondary metabolite produced by these mushrooms. The compound exerts its effects primarily through mechanisms related to modulation of cellular pathways, including anti-inflammatory, antioxidant, and potential antitumor activities.

Formula: C₂₂H₃₂O₂

Purity: Min. 95%

Molecular weight: 328.50 g/mol

Ref: 3D-YAA66596