CAS 23671-38-7
:1,3-Dihydro-1-(4-methylphenyl)-2H-imidazole-2-thione
Description:
1,3-Dihydro-1-(4-methylphenyl)-2H-imidazole-2-thione, with the CAS number 23671-38-7, is a heterocyclic compound featuring an imidazole ring. This compound is characterized by the presence of a thione functional group, which is a sulfur-containing moiety that can exhibit tautomerism with the corresponding thiol form. The structure includes a 4-methylphenyl substituent, contributing to its aromatic character and potentially influencing its solubility and reactivity. Typically, compounds of this nature may exhibit biological activity, making them of interest in medicinal chemistry and pharmacology. The thione group can participate in various chemical reactions, including nucleophilic attacks and coordination with metal ions, which may enhance its utility in coordination chemistry. Additionally, the presence of the methyl group on the phenyl ring can affect the compound's electronic properties and steric hindrance, influencing its interactions with other molecules. Overall, 1,3-Dihydro-1-(4-methylphenyl)-2H-imidazole-2-thione is a versatile compound with potential applications in various fields of chemistry and biochemistry.
Formula:C10H10N2S
InChI:InChI=1S/C10H10N2S/c1-8-2-4-9(5-3-8)12-7-6-11-10(12)13/h2-7H,1H3,(H,11,13)
InChI key:InChIKey=NKJDZCPGJDRNIV-UHFFFAOYSA-N
SMILES:S=C1N(C=CN1)C2=CC=C(C)C=C2
Synonyms:- 2-Mercapto-1-(4-methylphenyl)imidazole
- 2H-Imidazole-2-thione, 1,3-dihydro-1-(4-methylphenyl)-
- Imidazole-2-thiol, 1-p-tolyl-
- 2-Mercapto-1-p-tolylimidazole
- 1,3-Dihydro-1-(4-methylphenyl)-2H-imidazole-2-thione
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
