CymitQuimica logo

CAS 23674-20-6

:

9-Bromo-10-phenylanthracene

Description:
9-Bromo-10-phenylanthracene is an organic compound characterized by its polycyclic aromatic structure, which consists of an anthracene backbone substituted with a bromine atom at the 9-position and a phenyl group at the 10-position. This compound typically exhibits a high degree of stability due to the resonance of its aromatic rings. It is generally insoluble in water but soluble in organic solvents such as dichloromethane and chloroform. The presence of the bromine atom introduces a halogen functionality, which can enhance its reactivity in various chemical reactions, including electrophilic substitutions and cross-coupling reactions. Additionally, 9-bromo-10-phenylanthracene can exhibit interesting photophysical properties, making it a candidate for applications in organic electronics, such as organic light-emitting diodes (OLEDs) and organic photovoltaics (OPVs). Its molecular structure allows for potential interactions with other materials, which can be exploited in the development of advanced materials in the field of organic chemistry and materials science.
Formula:C20H13Br
InChI:InChI=1/C20H13Br/c21-20-17-12-6-4-10-15(17)19(14-8-2-1-3-9-14)16-11-5-7-13-18(16)20/h1-13H
InChI key:WHGGVVHVBFMGSG-UHFFFAOYSA-N
SMILES:c1ccc(cc1)c1c2ccccc2c(c2ccccc12)Br
Synonyms:
  • Anthracene, 9-Bromo-10-Phenyl-
  • 10-phenyl-9-Bromoanthracene
Found 7 products.