CAS 2368-53-8: 2,4-Dichloro-1,3,5-trifluorobenzene

Description:2,4-Dichloro-1,3,5-trifluorobenzene is an aromatic compound characterized by the presence of two chlorine atoms and three fluorine atoms attached to a benzene ring. Its molecular formula is C6Cl2F3, and it features a symmetrical arrangement of substituents, which contributes to its chemical stability and unique properties. This compound is typically a colorless to pale yellow liquid at room temperature and has a relatively high boiling point due to the presence of halogen atoms, which increase intermolecular forces. It is known for its low solubility in water but is soluble in organic solvents, making it useful in various applications, including as an intermediate in the synthesis of agrochemicals and pharmaceuticals. Additionally, 2,4-Dichloro-1,3,5-trifluorobenzene exhibits low volatility and is considered to have moderate toxicity, necessitating careful handling and storage. Its chemical behavior is influenced by the electronegative fluorine and chlorine atoms, which can affect reactivity and interactions with other substances.

Formula:C₆HCl₂F₃

InChI:InChI=1S/C6HCl2F3/c7-4-2(9)1-3(10)5(8)6(4)11/h1H

InChI key:InChIKey=UOGVNYNJSZHQCN-UHFFFAOYSA-N

SMILES:FC=1C=C(F)C(Cl)=C(F)C1Cl

Synonyms:
1,3,5-Trifluoro-2,4-dichlorobenzene
1,3-Dichloro-2,4,6-trifluorobenzene
Benzene, 2,4-Dichloro-1,3,5-Trifluoro-
2,4-Dichloro-1,3,5-trifluorobenzene

Found 5 products.

Product data	Purity	Price range	Estimated delivery
1,3-Dichloro-2,4,6-trifluorobenzene REF: 3B-D2868CAS: 2368-53-8	>97.0%(GC)	104.00 €	Mon 07 Apr 25
Benzene, 2,4-dichloro-1,3,5-trifluoro- REF: IN-DA002O4TCAS: 2368-53-8	97%	To inquire	Mon 14 Apr 25
1,3-Dichloro-2,4,6-trifluorobenzene REF: 54-PC4831CAS: 2368-53-8	97%	32.00 €~1,271.00 €	Tue 15 Apr 25
2,4-Dichloro-1,3,5-trifluorobenzene REF: 10-F330068CAS: 2368-53-8	95.0%	To inquire	Thu 24 Apr 25
2,4-Dichloro-1,3,5-Trifluorobenzene REF: 3D-FD82159CAS: 2368-53-8	Min. 95%	- - -	Discontinued product