CAS 23688-47-3

3-Bromo-1H-pyrrolo[3,2-b]pyridine

Description:

3-Bromo-1H-pyrrolo[3,2-b]pyridine is a heterocyclic organic compound characterized by its fused pyrrole and pyridine rings, which contribute to its unique chemical properties. The presence of a bromine atom at the 3-position of the pyrrole ring enhances its reactivity and can influence its biological activity. This compound typically exhibits a pale yellow to brown appearance and is soluble in organic solvents, making it suitable for various synthetic applications. Its structure allows for potential interactions with biological targets, which has garnered interest in medicinal chemistry, particularly in the development of pharmaceuticals. The compound may also participate in electrophilic substitution reactions due to the electron-withdrawing nature of the bromine substituent. Additionally, 3-Bromo-1H-pyrrolo[3,2-b]pyridine can serve as a building block in the synthesis of more complex molecules, highlighting its utility in organic synthesis and drug discovery. Safety data should be consulted before handling, as halogenated compounds can pose health risks.

Formula: C₇H₅BrN₂

InChI: InChI=1/C7H5BrN2/c8-5-4-10-6-2-1-3-9-7(5)6/h1-4,10H

SMILES: c1cc2c(c(c[nH]2)Br)nc1

1H-Pyrrolo[3,2-b]pyridine, 3-bromo-

CAS: 23688-47-3

Formula: C₇H₅BrN₂

Purity: 95%

Color and Shape: Solid

Molecular weight: 197.0320

Ref: IN-DA002O50

3-Bromo-4-azaindole

CAS: 23688-47-3

Purity: 95%

Molecular weight: 197.03

Ref: FT-B10796

3-Bromo-4-azaindole

CAS: 23688-47-3

3-Bromo-4-azaindole

Formula: C₇H₅BrN₂

Purity: 95%

Color and Shape: yellow to brown solid

Molecular weight: 197.03g/mol

Ref: 54-OR30680

3-Bromo-1H-pyrrolo[3,2-b]pyridine

CAS: 23688-47-3

Formula: C₇H₅BrN₂

Purity: 95%

Color and Shape: Solid

Molecular weight: 197.035

Ref: 10-F048860