CAS 2369-83-7
:2-Methylpyrazolo[1,5-a]pyrimidin-7-amine
Description:
2-Methylpyrazolo[1,5-a]pyrimidin-7-amine is a heterocyclic organic compound characterized by its pyrazolo and pyrimidine ring structures. It features a methyl group at the 2-position of the pyrazole ring and an amino group at the 7-position of the pyrimidine moiety. This compound is known for its potential biological activity, particularly in the field of medicinal chemistry, where it may serve as a scaffold for the development of pharmaceuticals. Its structure allows for various interactions with biological targets, making it of interest in drug discovery. The compound is typically solid at room temperature and may exhibit moderate solubility in polar solvents. Its molecular properties, such as melting point, boiling point, and reactivity, can vary based on the specific conditions and purity of the sample. As with many nitrogen-containing heterocycles, it may participate in various chemical reactions, including nucleophilic substitutions and cyclization processes, which can be exploited in synthetic organic chemistry. Safety and handling precautions should be observed due to its potential biological effects.
Formula:C7H8N4
InChI:InChI=1S/C7H8N4/c1-5-4-7-9-3-2-6(8)11(7)10-5/h2-4H,8H2,1H3
InChI key:InChIKey=ZEULJGWEVNSXFT-UHFFFAOYSA-N
SMILES:NC=1N2C(=CC(C)=N2)N=CC1
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.