CymitQuimica logo

CAS 2369-89-3

:

Pyrazolo[1,5-a]pyrimidin-7-amine, 2,5-dimethyl-

Description:
Pyrazolo[1,5-a]pyrimidin-7-amine, 2,5-dimethyl- is a heterocyclic organic compound characterized by a fused pyrazole and pyrimidine ring system. This compound features an amino group at the 7-position of the pyrazolo ring and two methyl groups at the 2 and 5 positions of the pyrimidine ring, contributing to its unique chemical properties. It is typically a solid at room temperature and may exhibit moderate solubility in polar solvents due to the presence of the amino group, which can engage in hydrogen bonding. The compound is of interest in medicinal chemistry, particularly for its potential biological activities, including anti-inflammatory and anticancer properties. Its structure allows for various chemical modifications, which can enhance its pharmacological profile. As with many nitrogen-containing heterocycles, it may also participate in various chemical reactions, such as nucleophilic substitutions or cyclizations, making it a versatile building block in organic synthesis. Safety data should be consulted for handling and usage, as with all chemical substances.
Formula:C8H10N4
InChI:InChI=1S/C8H10N4/c1-5-3-7(9)12-8(10-5)4-6(2)11-12/h3-4H,9H2,1-2H3
InChI key:PTDZZLRAEVFJCM-UHFFFAOYSA-N
SMILES:CC1=NC2=CC(=NN2C(=C1)N)C
Found 4 products.