CymitQuimica logo

CAS 23690-80-4

:

3-(1,2,3,4-tetrahydro-9H-carbazol-9-yl)propanoic acid

Description:
3-(1,2,3,4-tetrahydro-9H-carbazol-9-yl)propanoic acid, with the CAS number 23690-80-4, is an organic compound characterized by its unique structure that includes a carbazole moiety. This compound features a propanoic acid functional group, which contributes to its acidic properties. The tetrahydrocarbazole structure provides it with a bicyclic framework, enhancing its stability and potentially influencing its biological activity. Typically, compounds of this nature may exhibit properties such as moderate solubility in organic solvents and limited solubility in water, depending on the presence of polar functional groups. The presence of the propanoic acid group suggests that it can participate in acid-base reactions, making it relevant in various chemical contexts, including medicinal chemistry and organic synthesis. Additionally, due to its structural characteristics, it may interact with biological systems, potentially serving as a scaffold for drug development or as a ligand in biochemical applications. Overall, this compound's unique structure and functional groups contribute to its potential utility in various scientific fields.
Formula:C15H17NO2
InChI:InChI=1/C15H17NO2/c17-15(18)9-10-16-13-7-3-1-5-11(13)12-6-2-4-8-14(12)16/h1,3,5,7H,2,4,6,8-10H2,(H,17,18)
InChI key:HOLWINOWZVORSA-UHFFFAOYSA-N
SMILES:c1ccc2c(c1)c1CCCCc1n2CCC(=O)O
Synonyms:
  • 9H-Carbazole-9-propanoic acid, 1,2,3,4-tetrahydro-
Found 2 products.