CymitQuimica logo

CAS 2370-38-9

:

4-Methyleneproline

Description:
4-Methyleneproline, with the CAS number 2370-38-9, is a cyclic amino acid characterized by its unique structure, which includes a five-membered ring containing a nitrogen atom. This compound is an analog of proline, featuring a methylene group that introduces a double bond into the pyrrolidine ring. The presence of this double bond affects its reactivity and stability compared to proline. 4-Methyleneproline is known for its role in peptide synthesis and as a building block in the development of various bioactive compounds. It exhibits properties typical of amino acids, such as the ability to participate in hydrogen bonding and contribute to the overall conformation of peptides and proteins. Additionally, its structural features may influence the biological activity of peptides in which it is incorporated, making it of interest in medicinal chemistry and drug design. Overall, 4-Methyleneproline serves as a valuable compound in both synthetic and biological chemistry contexts.
Formula:C6H9NO2
InChI:InChI=1S/C6H9NO2/c1-4-2-5(6(8)9)7-3-4/h5,7H,1-3H2,(H,8,9)
InChI key:InChIKey=PEYQZZMUNYLHII-UHFFFAOYSA-N
SMILES:C(O)(=O)C1CC(=C)CN1
Synonyms:
  • DL-Proline, 4-methylene-
  • Proline, 4-methylene-
  • 4-Methylene-DL-proline
  • Proline, 4-methylene-, DL-
  • 4-Methyleneproline
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.