CAS 2370-61-8: (±)-o-Tyrosine
Description:(±)-o-Tyrosine, with the CAS number 2370-61-8, is an amino acid derivative of tyrosine, characterized by its aromatic structure and the presence of a hydroxyl group on the ortho position of the benzene ring. This compound exists as a racemic mixture, meaning it contains equal parts of both enantiomers, which can exhibit different biological activities. (±)-o-Tyrosine is soluble in water and exhibits properties typical of amino acids, such as the ability to participate in peptide bond formation. It is involved in various biochemical pathways, including those related to neurotransmitter synthesis and protein metabolism. The compound may also have implications in research related to neurobiology and pharmacology due to its structural similarity to other biologically active compounds. Its stability and reactivity can be influenced by factors such as pH and temperature, making it important to consider these conditions in experimental settings. Overall, (±)-o-Tyrosine serves as a valuable compound in both synthetic and biological chemistry contexts.
Formula:C9H11NO3
InChI:InChI=1S/C9H11NO3/c10-7(9(12)13)5-6-3-1-2-4-8(6)11/h1-4,7,11H,5,10H2,(H,12,13)
InChI key:InChIKey=WRFPVMFCRNYQNR-UHFFFAOYSA-N
SMILES:O=C(O)C(N)CC=1C=CC=CC1O
- Synonyms:
- (±)-o-Tyrosine
- 2-Amino-3-(2-hydroxyphenyl)propanoic acid
- 2-Azaniumyl-3-(2-hydroxyphenyl)propanoate
- 2-Hydroxyphenylalanine
- 2-amino-3-(1H-indol-3-yl)propan-1-ol ethanedioate (salt)
- 3-(2-Hydroxyphenyl)-DL-alanine~H-DL-Phe(2-OH)-OH
- <span class="text-smallcaps">DL</span>-2-Hydroxyphenylalanine
- <span class="text-smallcaps">DL</span>-Phenylalanine, 2-hydroxy-
- <span class="text-smallcaps">DL</span>-o-Tyrosine
- NSC 72345
- See more synonyms
- Ortho-tyrosine
- Phenylalanine, 2-hydroxy-
- o-<span class="text-smallcaps">DL</span>-Tyrosine
- o-Tyrosine, <span class="text-smallcaps">DL</span>-
- o-Tyrosine, DL-
- DL-Phenylalanine, 2-hydroxy-
- o-DL-Tyrosine
