CAS 237073-64-2
:ammonium (3R,5R)-7-[(1S,2S,6R,8S,8aR)-2,6-dimethyl-8-[(2S)-2-methylbutanoyl]oxy-1,2,6,7,8,8a-hexahydronaphthalen-1-yl]-3,5-dihydroxy-heptanoate
Description:
The chemical substance known as ammonium (3R,5R)-7-[(1S,2S,6R,8S,8aR)-2,6-dimethyl-8-[(2S)-2-methylbutanoyl]oxy-1,2,6,7,8,8a-hexahydronaphthalen-1-yl]-3,5-dihydroxy-heptanoate, with the CAS number 237073-64-2, is a complex organic compound characterized by its intricate stereochemistry and functional groups. It features a heptanoate backbone, which is a seven-carbon fatty acid derivative, and includes multiple hydroxyl (-OH) groups that contribute to its solubility and reactivity. The presence of a naphthalene-derived moiety indicates potential aromatic characteristics, while the ammonium group suggests it may exhibit basic properties. This compound is likely to be involved in biological processes, possibly serving as a precursor or active ingredient in pharmaceuticals or biochemicals. Its specific stereochemistry implies that it may interact selectively with biological targets, influencing its efficacy and safety profile. Overall, the compound's structural complexity and functional diversity make it a subject of interest in medicinal chemistry and related fields.
Formula:C24H41NO6
InChI:InChI=1/C24H38O6.H3N/c1-5-15(3)24(29)30-21-11-14(2)10-17-7-6-16(4)20(23(17)21)9-8-18(25)12-19(26)13-22(27)28;/h6-7,10,14-16,18-21,23,25-26H,5,8-9,11-13H2,1-4H3,(H,27,28);1H3/t14-,15-,16-,18+,19+,20-,21-,23-;/m0./s1
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
