CAS 23709-47-9

3-Nitro-7-azaindole

Description:

3-Nitro-7-azaindole is a heterocyclic organic compound characterized by the presence of both a nitro group and an azaindole structure. The compound features a nitrogen atom incorporated into the indole ring system, which contributes to its unique chemical properties. Typically, 3-nitro-7-azaindole exhibits moderate solubility in polar solvents due to its polar functional groups, while its aromatic nature allows for π-π stacking interactions. The nitro group, being an electron-withdrawing substituent, can influence the compound's reactivity, making it a potential candidate for various chemical reactions, including nucleophilic substitutions and electrophilic aromatic substitutions. Additionally, the presence of the azaindole moiety may impart biological activity, making it of interest in medicinal chemistry and drug development. Overall, 3-nitro-7-azaindole is a versatile compound with applications in research and potential therapeutic uses, owing to its unique structural features and reactivity.

Formula: C₇H₅N₃O₂

InChI: InChI=1/C7H5N3O2/c11-10(12)6-4-9-7-5(6)2-1-3-8-7/h1-4H,(H,8,9)

SMILES: c1cc2c(c[nH]c2nc1)N(=O)=O

Synonyms:

• 1H-pyrrolo[2,3-b]pyridine, 3-nitro-
• 3-Nitro-1H-pyrrolo[2,3-b]pyridin
• 3-Nitro-1H-pyrrolo[2,3-b]pyridine

3-nitro-1H-pyrrolo[2,3-b]pyridine

CAS: 23709-47-9

Formula: C₇H₅N₃O₂

Purity: 96%

Color and Shape: Solid

Molecular weight: 163.1335

Ref: IN-DA003JSV

3-Nitro-7-azaindole

CAS: 23709-47-9

3-Nitro-7-azaindole

Purity: 97%

Molecular weight: 163.13g/mol

Ref: 54-OR922183

3-Nitro-1H-pyrrolo[2,3-b]pyridine

CAS: 23709-47-9

Formula: C₇H₅N₃O₂

Purity: 96%

Molecular weight: 163.136

Ref: 10-F209334