CAS 2373-89-9
:4,4′-Dimethoxychalcone
Description:
4,4′-Dimethoxychalcone is an organic compound belonging to the chalcone class, characterized by its distinctive structure that features a central α,β-unsaturated carbonyl system flanked by two aromatic rings. This compound is typically a yellow to orange solid, exhibiting moderate solubility in organic solvents such as ethanol and dichloromethane, but limited solubility in water. It possesses two methoxy groups (-OCH₃) at the para positions of the aromatic rings, which can influence its chemical reactivity and biological activity. Chalcones, including 4,4′-Dimethoxychalcone, are known for their potential pharmacological properties, including anti-inflammatory, antioxidant, and anticancer activities. The presence of the methoxy groups can enhance the compound's lipophilicity, potentially affecting its bioavailability and interaction with biological targets. Additionally, 4,4′-Dimethoxychalcone can undergo various chemical reactions, such as oxidation and reduction, making it a versatile compound in synthetic organic chemistry and medicinal chemistry research.
Formula:C17H16O3
InChI:InChI=1S/C17H16O3/c1-19-15-8-3-13(4-9-15)5-12-17(18)14-6-10-16(20-2)11-7-14/h3-12H,1-2H3
InChI key:InChIKey=HDXVSZWKIHQDES-UHFFFAOYSA-N
SMILES:C(C=CC1=CC=C(OC)C=C1)(=O)C2=CC=C(OC)C=C2
Synonyms:- (2E)-1,3-bis(4-methoxyphenyl)prop-2-en-1-one
- 1,3-Bis(4-Methoxyphenyl)Prop-2-En-1-One
- 1,3-Bis(4-methoxyphenyl)-2-propen-1-one
- 1,3-Bis(4-methoxyphenyl)propenone
- 2-Propen-1-one, 1,3-bis(4-methoxyphenyl)-
- 4,4-Dimethoxybenzylideneacetophenone
- Chalcone, 4,4′-dimethoxy-
- NSC 87339
- p, p′-Dimethoxychalcone
- 4,4′-Dimethoxychalcone
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 8 products.
4,4'-Dimethoxychalcone, 99%
CAS:This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo SciFormula:C17H16O3Purity:99%Color and Shape:Pale yellow to yellow, Crystals or powder or crystalline powderMolecular weight:268.324,4'-Dimethoxychalcone
CAS:4,4'-Dimethoxychalcone analytical standard provided with chromatographic purity, to be used as reference material for qualitative determination.Formula:C17H16O3Purity:(HPLC) ≥95%Color and Shape:PowderMolecular weight:268.324,4'-Dimethoxychalcone
CAS:Formula:C17H16O3Purity:>98.0%(HPLC)(qNMR)Color and Shape:White to Light orange to Pale yellow green powder to crystalMolecular weight:268.314,4'-Dimethoxychalcone
CAS:4,4'-Dimethoxychalcone (4,4-Dimethoxychalcone) is a natural product.Formula:C17H16O3Purity:99.57%Color and Shape:SolidMolecular weight:268.31Ref: TM-T7985
2mg34.00€5mg47.00€10mg62.00€1mL*10mM (DMSO)94.00€25mg96.00€50mg140.00€100mg215.00€200mg318.00€4,4'-Dimethoxychalcone
CAS:4,4'-Dimethoxychalcone is a synthetic chemical compound, classified as a chalcone derivative. This compound is typically sourced through organic synthesis routes involving condensation reactions between appropriate aromatic aldehydes and ketones. The mode of action of 4,4'-Dimethoxychalcone is primarily linked to its capacity to modulate various biological pathways, including the inhibition of specific enzymes and interference with cell signaling pathways. These mechanisms render it an interesting candidate for exploration in pharmacological and biochemical research.Formula:C17H16O3Purity:Min. 95%Color and Shape:SolidMolecular weight:268.31 g/mol







