CAS 2373-89-9: 4,4′-Dimethoxychalcone
Description:4,4′-Dimethoxychalcone is an organic compound belonging to the chalcone class, characterized by its distinctive structure that features a central α,β-unsaturated carbonyl system flanked by two aromatic rings. This compound is typically a yellow to orange solid, exhibiting moderate solubility in organic solvents such as ethanol and dichloromethane, but limited solubility in water. It possesses two methoxy groups (-OCH₃) at the para positions of the aromatic rings, which can influence its chemical reactivity and biological activity. Chalcones, including 4,4′-Dimethoxychalcone, are known for their potential pharmacological properties, including anti-inflammatory, antioxidant, and anticancer activities. The presence of the methoxy groups can enhance the compound's lipophilicity, potentially affecting its bioavailability and interaction with biological targets. Additionally, 4,4′-Dimethoxychalcone can undergo various chemical reactions, such as oxidation and reduction, making it a versatile compound in synthetic organic chemistry and medicinal chemistry research.
Formula:C17H16O3
InChI:InChI=1S/C17H16O3/c1-19-15-8-3-13(4-9-15)5-12-17(18)14-6-10-16(20-2)11-7-14/h3-12H,1-2H3
InChI key:InChIKey=HDXVSZWKIHQDES-UHFFFAOYSA-N
SMILES:O=C(C=CC1=CC=C(OC)C=C1)C2=CC=C(OC)C=C2
- Synonyms:
- (2E)-1,3-bis(4-methoxyphenyl)prop-2-en-1-one
- 1,3-Bis(4-Methoxyphenyl)Prop-2-En-1-One
- 1,3-Bis(4-methoxyphenyl)-2-propen-1-one
- 1,3-Bis(4-methoxyphenyl)propenone
- 2-Propen-1-one, 1,3-bis(4-methoxyphenyl)-
- 4,4-Dimethoxybenzylideneacetophenone
- Chalcone, 4,4′-dimethoxy-
- NSC 87339
- p, p′-Dimethoxychalcone
- 4,4′-Dimethoxychalcone
- See more synonyms
