CAS 23740-25-2
:Lanuginosine
Description:
Lanuginosine is a naturally occurring chemical compound classified as a glycoside. It is primarily derived from the wool of sheep, where it is found in the form of a complex with fatty acids. Lanuginosine is characterized by its unique structure, which includes a sugar moiety linked to a non-sugar component, contributing to its biological activity. This compound is known for its potential applications in cosmetics and pharmaceuticals due to its moisturizing properties and ability to enhance skin barrier function. Additionally, lanuginosine exhibits antimicrobial properties, making it a candidate for use in various topical formulations. Its safety profile is generally favorable, but like many compounds, it should be used with caution in sensitive populations. As research continues, the full range of its biological effects and potential therapeutic applications is still being explored, highlighting the importance of ongoing studies in natural product chemistry.
Formula:C18H11NO4
InChI:InChI=1S/C18H11NO4/c1-21-10-2-3-11-12(7-10)17(20)16-14-9(4-5-19-16)6-13-18(15(11)14)23-8-22-13/h2-7H,8H2,1H3
InChI key:InChIKey=WLXLLQQGGGHOMA-UHFFFAOYSA-N
SMILES:O=C1C=2C3=C(C=4C1=CC(OC)=CC4)C5=C(C=C3C=CN2)OCO5
Synonyms:- 8H-Benzo[g]-1,3-benzodioxolo[6,5,4-de]quinolin-8-one, 10-methoxy-
- Lanuginosine
- Oxoxylopine
- 10-Methoxy-8H-benzo[g]-1,3-benzodioxolo[6,5,4-de]quinolin-8-one
- Noraporphin-7-one, 4,5,6,6a-tetradehydro-9-methoxy-1,2-(methylenedioxy)-
- 8H-1,3-benzodioxolo[6,5,4-de]benzo[g]quinolin-8-one, 10-methoxy-
- 10-Methoxy-8H-[1,3]benzodioxolo[6,5,4-de]benzo[g]quinolin-8-one
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Lanuginosine
CAS:Lanuginosine, an aporphine alkaloid, exhibits cytotoxicity against U251.Formula:C18H11NO4Color and Shape:SolidMolecular weight:305.28
