CAS 237412-04-3

2-[4-(1-methylethyl)phenoxy]propanoic acid

Description:

2-[4-(1-methylethyl)phenoxy]propanoic acid, also known by its CAS number 237412-04-3, is a chemical compound characterized by its structure, which includes a propanoic acid moiety linked to a phenoxy group. The presence of the isopropyl group (1-methylethyl) on the phenyl ring contributes to its hydrophobic characteristics, influencing its solubility and interaction with biological systems. This compound is typically classified as an aromatic carboxylic acid, which may exhibit properties such as moderate acidity due to the carboxylic acid functional group. Its phenoxy structure suggests potential applications in herbicides or plant growth regulators, as similar compounds are often utilized in agricultural chemistry. Additionally, the compound's molecular structure may impart specific reactivity patterns, making it of interest in synthetic organic chemistry. Overall, the characteristics of 2-[4-(1-methylethyl)phenoxy]propanoic acid highlight its potential utility in various chemical and agricultural applications.

Formula: C₁₂H₁₆O₃

InChI: InChI=1/C12H16O3/c1-8(2)10-4-6-11(7-5-10)15-9(3)12(13)14/h4-9H,1-3H3,(H,13,14)

SMILES: CC(C)c1ccc(cc1)OC(C)C(=O)O

Synonyms:

• 2-(4-Isopropylphenoxy)propanoic acid
• 2-[4-(Propan-2-Yl)Phenoxy]Propanoic Acid
• Propanoic Acid, 2-[4-(1-Methylethyl)Phenoxy]-

2-(4-isopropylphenoxy)propanoic acid

CAS: 237412-04-3

Formula: C₁₂H₁₆O₃

Purity: 95.0%

Molecular weight: 208.257

Ref: 10-F307510