CAS 237429-33-3

4-Mercaptophenylboronic acid

Description:

4-Mercaptophenylboronic acid is an organoboron compound characterized by the presence of both a boronic acid group and a thiol group attached to a phenyl ring. Its molecular structure features a boron atom bonded to a hydroxyl group and a phenyl ring, which is further substituted with a thiol (-SH) group at the para position. This compound is typically a white to off-white solid and is soluble in polar solvents such as water and alcohols, owing to the presence of the boronic acid and thiol functional groups. 4-Mercaptophenylboronic acid exhibits unique reactivity, particularly in forming reversible covalent bonds with diols, making it useful in various applications, including organic synthesis, sensor development, and as a building block in drug discovery. Additionally, its thiol group can participate in redox reactions and can be utilized in the formation of disulfide bonds, enhancing its utility in bioconjugation and materials science. Safety precautions should be observed when handling this compound, as with many organoboron and thiol-containing substances.

Formula: C₆H₇BO₂S

InChI: InChI=1/C6H7BO2S/c8-7(9)5-1-3-6(10)4-2-5/h1-4,8-10H

SMILES: c1cc(ccc1B(O)O)S

Synonyms:

• (4-Sulfanylphenyl)boronic acid
• boronic acid, B-(4-mercaptophenyl)-
• 4-Mercaptophenylboronicacid

4-Mercaptophenylboronic Acid (contains varying amounts of Anhydride)

CAS: 237429-33-3

Formula: C₆H₇BO₂S

Purity: 97.0 to 114.0 %

Color and Shape: White to Light yellow powder to crystal

Molecular weight: 153.99

Ref: 3B-M2418

Boronic acid, (4-mercaptophenyl)-

CAS: 237429-33-3

Formula: C₆H₇BO₂S

Purity: 95%

Color and Shape: Solid

Molecular weight: 153.9946

Ref: IN-DA00I4L7

4-Mercaptophenylboronic acid

CAS: 237429-33-3

4-Mercaptophenylboronic acid

Formula: C₆H₇BO₂S

Purity: 95%

Color and Shape: white solid

Molecular weight: 153.99g/mol

Ref: 54-OR315062

4-Mercaptophenylboronic acid

CAS: 237429-33-3

Formula: C₆H₇BO₂S

Purity: 90.0%

Color and Shape: Solid

Molecular weight: 153.99

Ref: 10-F092799

4-Mercaptophenylboronic acid

CAS: 237429-33-3

4-Mercaptophenylboronicacid is a boronic acid that has been used to synthesize gold nanoparticles with antimicrobial properties. Boronic acids are able to form hydrogen bonds with biological molecules such as proteins and DNA, which allows them to be used for immobilization of biomolecules. This compound is also used as a reagent for the synthesis of disulfide bonds in proteins and peptides. 4-Mercaptophenylboronicacid can be used to prepare samples for electrochemical impedance spectroscopy (EIS) and colorimetric analysis.

Formula: C₆H₇BO₂S

Purity: Min. 95%

Molecular weight: 154 g/mol

Ref: 3D-FM149407