CAS 2374313-54-7
:2-Thiophenecarboxylic acid, 2-hexadecylhydrazide
Description:
2-Thiophenecarboxylic acid, 2-hexadecylhydrazide is a chemical compound characterized by its unique structure, which includes a thiophene ring and a hydrazide functional group. The presence of the thiophene moiety imparts aromatic properties, while the carboxylic acid group contributes to its acidity and potential for hydrogen bonding. The hexadecyl chain enhances the hydrophobic characteristics of the molecule, making it more soluble in non-polar solvents. This compound may exhibit biological activity due to the hydrazide functionality, which is often associated with various pharmacological properties. Additionally, the length of the alkyl chain can influence its physical properties, such as melting point and boiling point, as well as its interactions with biological membranes. Overall, 2-Thiophenecarboxylic acid, 2-hexadecylhydrazide is of interest in fields such as medicinal chemistry and materials science, where its unique properties can be leveraged for various applications. Further studies would be necessary to fully elucidate its reactivity and potential uses.
Formula:C21H38N2OS
InChI:InChI=1S/C21H38N2OS/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-18-22-23-21(24)20-17-16-19-25-20/h16-17,19,22H,2-15,18H2,1H3,(H,23,24)
InChI key:InChIKey=HSHXDCVZWHOWCS-UHFFFAOYSA-N
SMILES:C(NNCCCCCCCCCCCCCCCC)(=O)C1=CC=CS1
Synonyms:- 2-Thiophenecarboxylic acid, 2-hexadecylhydrazide
- SIS 17
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
SIS17
CAS:<p>SIS17: Potent, selective HDAC11 inhibitor (IC50: 0.83 μM), blocks serine hydroxymethyl transferase 2 demyristoylation, spares other HDACs.</p>Formula:C21H38N2OSPurity:98.22%Color and Shape:SolidMolecular weight:366.6SIS17
CAS:<p>SIS17 is a synthetic inhibitor used in molecular biology, which is derived from chemical synthesis with the specific function of modulating gene expression. It operates through binding to specific DNA sequences, thereby blocking or altering the recruitment of transcription machinery necessary for gene expression. This mechanism allows researchers to precisely control the temporal and spatial expression of target genes.</p>Formula:C21H38N2OSPurity:Min. 95%Color and Shape:PowderMolecular weight:366.6 g/molSIS17 - Bio-X ™
CAS:<p>This product is part of our Bio-X ™ Range. These products are aimed at life science researchers who need high quality ready-to-use products for assay development, screening or other R&D work. With a solubility datasheet and convenient vials, all of our Bio-X ™ products are in stock across our global warehouses for rapid delivery and ease of use.</p>Formula:C21H38N2OSPurity:Min. 95%Color and Shape:PowderMolecular weight:366.6 g/mol




