CAS 23755-35-3
:2-O-Methyl-¤-D-N-acetylneuraminic acid
Description:
2-O-Methyl-α-D-N-acetylneuraminic acid, identified by its CAS number 23755-35-3, is a derivative of sialic acid, which is a family of nine-carbon sugars known for their role in cellular recognition and signaling. This compound features a methyl group at the 2-position of the neuraminic acid backbone, which can influence its biological activity and interactions. It is typically characterized by its molecular structure, which includes an acetamido group and a carboxylic acid functional group, contributing to its solubility in polar solvents. The presence of the methyl group can enhance its stability and alter its binding properties compared to its non-methylated counterparts. 2-O-Methyl-α-D-N-acetylneuraminic acid is of interest in biochemical research, particularly in studies related to glycoproteins and glycolipids, as well as in the development of therapeutics targeting viral infections and other diseases where sialic acid plays a crucial role. Its specific interactions and applications continue to be explored in various fields, including immunology and virology.
Formula:C12H21NO9
InChI:InChI=1/C12H21NO9/c1-5(15)13-8-6(16)3-12(21-2,11(19)20)22-10(8)9(18)7(17)4-14/h6-10,14,16-18H,3-4H2,1-2H3,(H,13,15)(H,19,20)/t6?,7-,8?,9-,10?,12?/m1/s1
SMILES:CC(=NC1C(CC(C(=O)O)(OC)OC1[C@@H]([C@@H](CO)O)O)O)O
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
N-Acetyl-2-O-methyl-b-D-neuraminic acid
CAS:N-Acetyl-2-O-methyl-b-D-neuraminic acid (AOMBNA) is a modification of sialic acid. It is an N-acetylated, O-methylated analogue of b-D-neuraminic acid. AOMBNA is synthesized by the chemical modification of D,L -erythro -2,3,4,6 tetra hydro sialic acid with methyl bromo acetate in the presence of sodium methoxide. The product can be purified by crystallization from dichloromethane and methanol mixture. AOMBNA has been used in complex carbohydrate synthesis and glycosylation reactions.Formula:C12H21NO9Purity:Min. 95%Color and Shape:PowderMolecular weight:323.3 g/mol2-O-Methyl-β-D-N-acetylneuraminic Acid-13CD3
CAS:Controlled ProductFormula:CC11D3H18NO9Color and Shape:NeatMolecular weight:327.308


