CAS 23758-27-2

1-methylcyclohex-2-en-1-ol

Description:

1-Methylcyclohex-2-en-1-ol, with the CAS number 23758-27-2, is an organic compound characterized by its cyclic structure and the presence of both an alkene and an alcohol functional group. It features a cyclohexene ring with a methyl group and a hydroxyl group attached to the same carbon atom, contributing to its unique reactivity and properties. This compound is typically a colorless to pale yellow liquid with a pleasant odor, making it of interest in various applications, including fragrance and flavor industries. Its molecular structure allows for potential hydrogen bonding due to the hydroxyl group, which can influence its solubility in polar solvents. Additionally, the presence of the double bond in the cyclohexene ring can participate in various chemical reactions, such as electrophilic additions or polymerization. The compound's stability and reactivity can be affected by factors such as temperature and the presence of catalysts. Overall, 1-methylcyclohex-2-en-1-ol is a versatile compound with applications in organic synthesis and industrial chemistry.

Formula: C₇H₁₂O

InChI: InChI=1/C7H12O/c1-7(8)5-3-2-4-6-7/h3,5,8H,2,4,6H2,1H3

SMILES: CC1(C=CCCC1)O

Synonyms:

• 1-Methyl-2-Cyclohexen-1-Ol
• 2-Cyclohexen-1-ol, 1-methyl-

1-Methylcyclohex-2-en-1-ol

Controlled Product

CAS: 23758-27-2

Formula: C₇H₁₂O

Color and Shape: Neat

Molecular weight: 112.17

Ref: TR-B497218