CAS 2376-89-8
:Phenothiazine, 10,10′-[1,4-piperazinediylbis(trimethylene)]bis[2-(trifluoromethyl)-
Description:
Phenothiazine, 10,10′-[1,4-piperazinediylbis(trimethylene)]bis[2-(trifluoromethyl)-, identified by CAS number 2376-89-8, is a chemical compound that belongs to the phenothiazine family, which is known for its use in pharmaceuticals, particularly as antipsychotic agents. This compound features a phenothiazine core, characterized by a sulfur atom and two nitrogen atoms in a tricyclic structure, which contributes to its biological activity. The presence of the trifluoromethyl groups enhances its lipophilicity and may influence its pharmacokinetic properties. Additionally, the piperazine moiety linked by trimethylene units suggests potential for interaction with neurotransmitter receptors, making it of interest in medicinal chemistry. The compound is typically solid at room temperature and may exhibit moderate solubility in organic solvents. Its unique structure allows for various chemical modifications, which can lead to different biological activities, making it a subject of research in drug development and synthesis. Safety and handling precautions should be observed due to the potential toxicity associated with phenothiazine derivatives.
Formula:C36H34F6N4S2
InChI:InChI=1S/C36H34F6N4S2/c37-35(38,39)25-11-13-33-29(23-25)45(27-7-1-3-9-31(27)47-33)17-5-15-43-19-21-44(22-20-43)16-6-18-46-28-8-2-4-10-32(28)48-34-14-12-26(24-30(34)46)36(40,41)42/h1-4,7-14,23-24H,5-6,15-22H2
InChI key:InChIKey=LLOXFCOBHLPZTG-UHFFFAOYSA-N
SMILES:C(CCN1CCN(CCCN2C=3C(SC=4C2=CC=CC4)=CC=C(C(F)(F)F)C3)CC1)N5C=6C(SC=7C5=CC=CC7)=CC=C(C(F)(F)F)C6
Synonyms:- Phenothiazine, 10,10′-[1,4-piperazinediylbis(trimethylene)]bis[2-(trifluoromethyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 4 products.
Fluphenazine Dihydrochloride EP Impurity D
CAS:Formula:C36H34F6N4S2Color and Shape:White To Off-White SolidMolecular weight:700.8110,10'-[Piperazine-1,4-diylbis(propane-3,1-diyl)]bis[2-(trifluoromethyl)-10H-phenothiazine]
CAS:Formula:C36H34F6N4S2Color and Shape:NeatMolecular weight:700.801,4-Bis(3-(2-(trifluoromethyl)-10H-phenothiazin-10-yl)propyl)piperazine
CAS:Controlled ProductFormula:C36H34F6N4S2Color and Shape:NeatMolecular weight:700.8



