
CAS 23776-98-9
:({[4-(acetylamino)phenyl]sulfonyl}amino)acetate
Description:
The chemical substance known as "({[4-(acetylamino)phenyl]sulfonyl}amino)acetate," with the CAS number 23776-98-9, is characterized by its complex structure that includes an acetylamino group, a sulfonyl group, and an acetate moiety. This compound typically exhibits properties associated with both amines and sulfonamides, which may influence its solubility and reactivity. It is likely to be a solid at room temperature, with potential applications in pharmaceuticals or as a biochemical reagent due to its functional groups. The presence of the sulfonyl group suggests it may have good stability and solubility in polar solvents. Additionally, the acetylamino group can enhance its biological activity, making it a candidate for further research in medicinal chemistry. The compound's molecular interactions may be significant in biological systems, potentially affecting enzyme activity or receptor binding. Overall, its unique structural features contribute to its potential utility in various chemical and biological applications.
Formula:C10H11N2O5S
InChI:InChI=1/C10H12N2O5S/c1-7(13)12-8-2-4-9(5-3-8)18(16,17)11-6-10(14)15/h2-5,11H,6H2,1H3,(H,12,13)(H,14,15)/p-1
SMILES:CC(=Nc1ccc(cc1)S(=O)(=O)NCC(=O)O)[O-]
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
N-4-Acetamidophenylsulfonylglycine
CAS:Controlled ProductFormula:C10H12N2O5SColor and Shape:NeatMolecular weight:272.2782-(4-Acetamidobenzenesulfonamido)acetic acid
CAS:2-(4-Acetamidobenzenesulfonamido)acetic acid is an inorganic compound that has been synthesized for the first time. It was crystallized by x-ray diffraction and has been shown to have a supramolecular structure. The crystals are polymeric, with carboxylate groups at one end and benzene rings at the other. 2-(4-Acetamidobenzenesulfonamido)acetic acid can interact with neodymium ions due to its carboxylate groups, which form hydrogen bonds with the ion. This interaction can be seen in x-ray crystallography.Formula:C10H12N2O5SPurity:Min. 95%Molecular weight:272.28 g/mol

