CAS 23779-97-7
:4-Chloro-8-(trifluoromethyl)quinoline
Description:
4-Chloro-8-(trifluoromethyl)quinoline is a chemical compound belonging to the quinoline family, characterized by a bicyclic structure that includes a benzene ring fused to a pyridine ring. This compound features a chlorine atom at the 4-position and a trifluoromethyl group at the 8-position, which significantly influences its chemical properties and reactivity. The presence of the trifluoromethyl group enhances lipophilicity and can affect the compound's biological activity, making it of interest in medicinal chemistry. 4-Chloro-8-(trifluoromethyl)quinoline is typically a solid at room temperature and may exhibit moderate solubility in organic solvents. Its unique structure allows for potential applications in pharmaceuticals, agrochemicals, and materials science. Additionally, the compound may exhibit specific biological activities, including antimicrobial or antitumor properties, which are often investigated in drug development. Safety and handling precautions should be observed, as with many halogenated compounds, due to potential toxicity and environmental impact.
Formula:C10H5ClF3N
InChI:InChI=1S/C10H5ClF3N/c11-8-4-5-15-9-6(8)2-1-3-7(9)10(12,13)14/h1-5H
InChI key:InChIKey=LINGICLAECZKAW-UHFFFAOYSA-N
SMILES:C(F)(F)(F)C=1C2=C(C(Cl)=CC=N2)C=CC1
Synonyms:- 5,5,5-Trifluoronorvaline
- Quinoline, 4-chloro-8-(trifluoromethyl)-
- 4-Chloro-8-(trifluoromethyl)quinoline
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
4-Chloro-8-(trifluoromethyl)quinoline
CAS:Formula:C10H5ClF3NPurity:98%Color and Shape:SolidMolecular weight:231.60164-Chloro-8-(trifluoromethyl)quinoline
CAS:4-Chloro-8-(trifluoromethyl)quinolinePurity:98%Molecular weight:231.60g/mol4-Chloro-8-(trifluoromethyl)quinoline
CAS:Formula:C10H5ClF3NPurity:>98.0%(GC)Color and Shape:White to Light yellow powder to crystalMolecular weight:231.604-Chloro-8-(trifluoromethyl)quinoline
CAS:Formula:C10H5ClF3NPurity:98%Color and Shape:SolidMolecular weight:231.64-Chloro-8-(trifluoromethyl)quinoline
CAS:Controlled ProductApplications 4-Chloro-8-(trifluoromethyl)quinoline is used as a reagent for the potent CRTh2 (DP2) receptor antagonists discovery which is used for treatment of asthma, allergic rhinitis and other inflammatory diseases.
References Birkinshaw, T.N., et al.: Bioorg. Med. Chem. Lett., 16, 4287 (2006)Formula:C10H5ClF3NColor and Shape:NeatMolecular weight:231.64-Chloro-8-(trifluoromethyl)quinoline
CAS:4-Chloro-8-(trifluoromethyl)quinoline is a functionalized organic compound that is used as an antimicrobial agent. It has been shown to inhibit the growth of bacteria by reacting with nucleophilic sites on the surface of metal, thereby preventing the formation of corrosive substances. It also has properties that make it an excellent corrosion inhibitor. 4-Chloro-8-(trifluoromethyl)quinoline binds strongly to amines and acidic sites on metal surfaces, which are common features in bacterial cell walls, leading to its antimicrobial activity. This compound can be used as a cross-coupling agent in chemical reactions and electrochemical methods.Purity:Min. 95%





