CAS 23780-13-4

(2-phenyl-1,3-thiazol-4-yl)methanol

Description:

(2-phenyl-1,3-thiazol-4-yl)methanol is an organic compound characterized by its thiazole ring, which is a five-membered heterocyclic structure containing both sulfur and nitrogen atoms. The presence of a phenyl group attached to the thiazole enhances its aromatic properties and can influence its reactivity and solubility. The methanol functional group (-CH2OH) contributes to its potential as a hydroxyl-containing compound, which may participate in hydrogen bonding and increase its polarity. This compound may exhibit biological activity, making it of interest in medicinal chemistry and drug development. Its molecular structure suggests potential applications in various fields, including pharmaceuticals and agrochemicals. The compound's properties, such as melting point, boiling point, solubility, and spectral characteristics (like NMR and IR), would be essential for understanding its behavior in different environments and its interactions with other substances. Overall, (2-phenyl-1,3-thiazol-4-yl)methanol represents a versatile structure with potential utility in various chemical applications.

Formula: C₁₀H₉NOS

InChI: InChI=1/C10H9NOS/c12-6-9-7-13-10(11-9)8-4-2-1-3-5-8/h1-5,7,12H,6H2

SMILES: c1ccc(cc1)c1nc(CO)cs1

Synonyms:

• (2-Phenyl-thiazol-4-yl)-methanol

(2-Phenylthiazol-4-yl)methanol

CAS: 23780-13-4

Formula: C₁₀H₉NOS

Purity: 98%

Color and Shape: Solid

Molecular weight: 191.2496

Ref: IN-DA007N7E

4-(Hydroxymethyl)-2-phenyl-1,3-thiazole

CAS: 23780-13-4

4-(Hydroxymethyl)-2-phenyl-1,3-thiazole

Formula: C₁₀H₉NOS

Purity: ≥95%

Color and Shape: cream crystalline powder

Molecular weight: 191.25g/mol

Ref: 54-OR23285

(2-PHENYLTHIAZOL-4-YL)METHANOL

CAS: 23780-13-4

Formula: C₁₀H₉NOS

Purity: 95%

Color and Shape: Solid

Molecular weight: 191.25

Ref: 10-F306693

4-(Hydroxymethyl)-2-phenyl-1,3-thiazole

CAS: 23780-13-4

4-(Hydroxymethyl)-2-phenyl-1,3-thiazole is a versatile compound that has various applications in research and chemical synthesis. It is commonly used as a building block for the synthesis of organic compounds, including antibodies and research chemicals. This compound has been found to exhibit potent antiangiogenic properties, making it valuable in the field of cancer research. Additionally, 4-(Hydroxymethyl)-2-phenyl-1,3-thiazole can be used as a precursor in the synthesis of important pharmaceuticals such as cephalosporins and taxol. Its unique structure allows for diverse chemical reactions, making it an essential tool for chemists and researchers alike. Whether you're working on developing new drugs or exploring novel chemical reactions, 4-(Hydroxymethyl)-2-phenyl-1,3-thiazole is an indispensable compound that will help drive your scientific endeavors forward.

Formula: C₁₀H₉NOS

Purity: Min. 95%

Molecular weight: 191.25 g/mol

Ref: 3D-YAA78013