CymitQuimica logo

CAS 23784-10-3

:

4-hydroxybenzoic acid - 1-[1-(2-chlorobenzyl)-1H-pyrrol-2-yl]-2-(dibutan-2-ylamino)ethanol (1:1)

Description:
4-Hydroxybenzoic acid - 1-[1-(2-chlorobenzyl)-1H-pyrrol-2-yl]-2-(dibutan-2-ylamino)ethanol (1:1), with CAS number 23784-10-3, is a complex organic compound characterized by its unique structural features. It contains a hydroxybenzoic acid moiety, which contributes to its potential as a phenolic compound, and a pyrrole ring that may impart biological activity. The presence of a chlorobenzyl group suggests potential interactions with biological targets, while the dibutan-2-ylamino group indicates the presence of a tertiary amine, which can influence solubility and reactivity. This compound may exhibit properties such as antimicrobial or anti-inflammatory activity, typical of many derivatives of hydroxybenzoic acids. Its molecular structure suggests it could participate in hydrogen bonding due to the hydroxyl group, enhancing its solubility in polar solvents. Additionally, the presence of multiple functional groups may allow for diverse chemical reactivity, making it a candidate for various applications in pharmaceuticals or materials science. However, specific biological or physical properties would require empirical investigation.
Formula:C28H37ClN2O4
InChI:InChI=1/C21H31ClN2O.C7H6O3/c1-5-16(3)24(17(4)6-2)15-21(25)20-12-9-13-23(20)14-18-10-7-8-11-19(18)22;8-6-3-1-5(2-4-6)7(9)10/h7-13,16-17,21,25H,5-6,14-15H2,1-4H3;1-4,8H,(H,9,10)
Synonyms:
  • benzoic acid, 4-hydroxy-, compd. with alpha-[[bis(1-methylpropyl)amino]methyl]-1-[(2-chlorophenyl)methyl]-1H-pyrrole-2-methanol (1:1)
  • 23784-10-3 {p-Hydroxybenzoate}
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.